CAS 2051-85-6
:2,4-Dihydroxyazobenzene
Description:
2,4-Dihydroxyazobenzene, with the CAS number 2051-85-6, is an organic compound characterized by its azo group (-N=N-) linking two aromatic rings, specifically benzene derivatives. This compound features two hydroxyl (-OH) groups positioned at the 2 and 4 positions of one of the benzene rings, contributing to its solubility in water and potential reactivity. It typically appears as a solid, often with a yellow to orange color due to the presence of the azo linkage, which can absorb visible light. 2,4-Dihydroxyazobenzene is known for its applications in dye chemistry, particularly in the synthesis of azo dyes, and may also serve as an intermediate in various chemical reactions. Additionally, it has been studied for its potential biological activities, including antioxidant properties. However, like many azo compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Its stability and reactivity can vary based on environmental conditions, such as pH and temperature.
Formula:C12H10N2O2
InChI:InChI=1S/C12H10N2O2/c15-10-6-7-11(12(16)8-10)14-13-9-4-2-1-3-5-9/h1-8,15-16H
InChI key:InChIKey=BPTKLSBRRJFNHJ-UHFFFAOYSA-N
SMILES:N(=NC1=CC=CC=C1)C2=C(O)C=C(O)C=C2
Synonyms:- Sudan G
- 1,3-Benzenediol, 4-(phenylazo)-
- C.I. Solvent Orange 1
- 4-(2-Phenyldiazenyl)-1,3-benzenediol
- 1,3-Benzenediol, 4-(2-phenyldiazenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Sudan Orange G (C.I. 11920)
CAS:Formula:C12H10N2O2Color and Shape:Red to orange powderMolecular weight:214.22Sudan Orange G
CAS:SUDAN ORANGE G is a natural product.Formula:C12H10N2O2Purity:98%Color and Shape:SolidMolecular weight:214.22Sudan Orange G
CAS:<p>Applications Sudan Orange G is an oil soluble synthetic dye. Sudan Orange G can be degraded by a bacterial strain known as Pseudomonas putida MET94. Dyes and metabolites, Environmental Testing<br>References Zhu, Y., et. al.: Food Chem., 145, 956 (2014); Mendes, S., et. al.: Appl. Microbiol. Biot., 92, 393 (2011)<br></p>Formula:C12H10N2O2Color and Shape:Dark OrangeMolecular weight:214.22Sudan Orange G
CAS:Formula:C12H10N2O2Purity:90%+(LC-MS);RGColor and Shape:SolidMolecular weight:214.224Sudan Orange G (~85%)
CAS:Controlled Product<p>Applications Sudan Orange G is an oil soluble synthetic dye. Sudan Orange G can be degraded by a bacterial strain known as Pseudomonas putida MET94. Dyes and metabolites, Environmental Testing<br>References Zhu, Y., et. al.: Food Chem., 145, 956 (2014); Mendes, S., et. al.: Appl. Microbiol. Biot., 92, 393 (2011)<br></p>Formula:C12H10N2O2Purity:~85%Color and Shape:NeatMolecular weight:214.22






