CAS 205171-04-6
:6-Chloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-beta-D-ribofuranosyl)-9H-purine
Description:
6-Chloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-beta-D-ribofuranosyl)-9H-purine is a purine derivative characterized by the presence of a chlorine atom at the 6-position and a ribofuranosyl moiety that is heavily benzoylated at the 2, 3, and 5 positions. This compound features a complex structure that combines a purine base with a modified sugar, which enhances its stability and solubility. The benzoyl groups serve to protect the hydroxyl groups of the ribofuranosyl unit, making it more resistant to hydrolysis. The presence of the C-methyl group adds steric hindrance, which can influence the compound's biological activity and interaction with enzymes. This compound may exhibit interesting pharmacological properties, potentially acting as an antiviral or anticancer agent, due to its structural similarity to nucleosides. Its synthesis and characterization are of interest in medicinal chemistry, particularly in the development of nucleoside analogs for therapeutic applications.
Formula:C32H25ClN4O7
InChI:InChI=1/C32H25ClN4O7/c1-32(44-30(40)22-15-9-4-10-16-22)25(43-29(39)21-13-7-3-8-14-21)23(17-41-28(38)20-11-5-2-6-12-20)42-31(32)37-19-36-24-26(33)34-18-35-27(24)37/h2-16,18-19,23,25,31H,17H2,1H3/t23-,25-,31-,32-/m1/s1
SMILES:C[C@]1([C@@H]([C@@H](COC(=O)c2ccccc2)O[C@H]1n1cnc2c(Cl)ncnc12)OC(=O)c1ccccc1)OC(=O)c1ccccc1
Synonyms:- 9H-purine, 6-chloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-beta-D-ribofuranosyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
6-Chloro-9-(2,3,5-tri-o-benzoyl-2-c-methyl-β-d-ribofuranosyl)-9h-purine
CAS:Formula:C32H25ClN4O7Molecular weight:613.01656-Chloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)-9H-purine
CAS:6-Chloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)-9H-purine is a 2'-C-Methyl nucleoside; Halo-nucleoside.Formula:C32H25ClN4O7Color and Shape:SolidMolecular weight:613.02Ref: TM-TNU0772
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire

