CAS 205171-05-7
:6-Chloro-9-(2-C-methyl-beta-D-ribofuranosyl)-9H-purine
Description:
6-Chloro-9-(2-C-methyl-beta-D-ribofuranosyl)-9H-purine, with the CAS number 205171-05-7, is a purine derivative characterized by the presence of a chlorine atom at the 6-position and a ribofuranosyl moiety at the 9-position. This compound is notable for its structural similarity to nucleosides, which are essential components of nucleic acids. The C-methyl substitution on the ribofuranosyl ring enhances its stability and may influence its biological activity. Typically, purine derivatives like this one exhibit a range of biological properties, including potential antiviral and anticancer activities, due to their ability to interfere with nucleic acid synthesis. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its synthesis and characterization are of interest in medicinal chemistry, particularly in the development of nucleoside analogs for therapeutic applications. Overall, 6-Chloro-9-(2-C-methyl-beta-D-ribofuranosyl)-9H-purine represents a significant compound in the study of nucleoside chemistry and its applications in drug development.
Formula:C11H13ClN4O4
InChI:InChI=1/C11H13ClN4O4/c1-11(19)7(18)5(2-17)20-10(11)16-4-15-6-8(12)13-3-14-9(6)16/h3-5,7,10,17-19H,2H2,1H3/t5-,7-,10-,11-/m1/s1
SMILES:C[C@]1([C@@H]([C@@H](CO)O[C@H]1n1cnc2c(Cl)ncnc12)O)O
Synonyms:- 9H-purine, 6-chloro-9-(2-C-methyl-beta-D-ribofuranosyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
9H-Purine, 6-chloro-9-(2-C-methyl-β-D-ribofuranosyl)-
CAS:Formula:C11H13ClN4O4Purity:98%Color and Shape:SolidMolecular weight:300.69836-Chloro-9-(2-C-methyl-β-D-ribofuranosyl)-9H-purine
CAS:6-Chloro-9-(2-C-methyl-β-D-ribofuranosyl)-9H-purinePurity:98%Molecular weight:300.7g/mol6-Chloro-9-(2-C-methyl-β-D-ribofuranosyl)-9H-purine
CAS:Controlled ProductFormula:C11H13ClN4O4Color and Shape:NeatMolecular weight:300.6986-Chloro-9-(2-C-methyl-beta-D-ribofuranosyl)-9H-purine
CAS:6-Chloro-9-(2-C-methyl-beta-D-ribofuranosyl)-9H-purine is a novel nucleoside analogue. It is synthesized by reacting 2,6-dichloro 9-(2'-C-methyl beta D ribofuranosyl) 9H purine with methyl bromoacetate in the presence of sodium methoxide in methanol. 6-chloro 9-(2'-C-methyl beta D ribofuranosyl) 9H purine has antiviral activity against DNA and RNA viruses that are sensitive to it. It is phosphoramidite and can be used for DNA synthesis.Formula:C11H13ClN4O4Purity:Min. 95%Molecular weight:300.7 g/mol





