CAS 205194-11-2

[(3R)-1-methylpiperidin-3-yl]methanol

Description:

[(3R)-1-methylpiperidin-3-yl]methanol is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a methyl group attached to the nitrogen atom of the piperidine ring and a hydroxymethyl group (-CH2OH) linked to the carbon adjacent to the nitrogen, specifically at the 3-position of the ring. This configuration imparts chirality to the molecule, with the (3R) designation indicating the specific three-dimensional arrangement of atoms around the chiral center. The presence of the hydroxymethyl group suggests that the compound may exhibit polar characteristics, potentially making it soluble in polar solvents. Additionally, the piperidine moiety is known for its basicity and ability to participate in hydrogen bonding, which can influence the compound's reactivity and interactions in various chemical environments. Overall, [(3R)-1-methylpiperidin-3-yl]methanol may have applications in medicinal chemistry and organic synthesis due to its unique structural features.

Formula: C₇H₁₅NO

InChI: InChI=1/C7H15NO/c1-8-4-2-3-7(5-8)6-9/h7,9H,2-6H2,1H3/t7-/m1/s1

SMILES: CN1CCC[C@H](C1)CO

3-Piperidinemethanol, 1-methyl-, (3R)-

CAS: 205194-11-2

Formula: C₇H₁₅NO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 129.2001

Ref: IN-DA0029XH

(R)-1-Methyl-3-(hydroxymethyl)piperidine

CAS: 205194-11-2

(R)-1-Methyl-3-(hydroxymethyl)piperidine

Purity: 95%

Molecular weight: 129.20g/mol

Ref: 54-OR15995

(R)-1-METHYL-3-(HYDROXYMETHYL)PIPERIDINE

CAS: 205194-11-2

Formula: C₇H₁₅NO

Purity: 97%

Molecular weight: 129.203

Ref: 10-F501973