CymitQuimica logo

CAS 205194-35-0

:

[(3S)-1-methylpiperidin-3-yl]methanol

Description:
[(3S)-1-methylpiperidin-3-yl]methanol is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a methyl group attached to the nitrogen atom of the piperidine ring and a hydroxymethyl group (-CH2OH) at the 3-position, contributing to its unique properties. This configuration imparts chirality to the molecule, with the (3S) designation indicating the specific stereochemistry at the chiral center. The presence of the hydroxymethyl group enhances its potential for hydrogen bonding, which can influence its solubility and reactivity in various solvents. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The molecular structure allows for interactions with biological targets, potentially leading to therapeutic applications. As with many organic compounds, the physical properties such as melting point, boiling point, and solubility can vary based on environmental conditions and the presence of other substances.
Formula:C7H15NO
InChI:InChI=1/C7H15NO/c1-8-4-2-3-7(5-8)6-9/h7,9H,2-6H2,1H3/t7-/m0/s1
InChI key:UGXQXVDTGJCQHR-ZETCQYMHSA-N
SMILES:CN1CCC[C@@H](C1)CO
Found 3 products.