CAS 2052-15-5
:Butyl levulinate
Description:
Butyl levulinate, with the CAS number 2052-15-5, is an ester derived from levulinic acid and butanol. It is characterized by its pleasant fruity odor and is typically a colorless to pale yellow liquid at room temperature. This compound is known for its relatively low toxicity and biodegradability, making it an attractive candidate for use as a green solvent and in various applications, including flavoring and fragrance formulations. Butyl levulinate exhibits good solubility in organic solvents and moderate solubility in water, which enhances its versatility in chemical processes. Its chemical structure includes a butyl group attached to the levulinate moiety, contributing to its unique properties. Additionally, butyl levulinate has been studied for its potential as a biofuel additive due to its favorable combustion characteristics. Overall, butyl levulinate represents a valuable compound in both industrial and research settings, particularly in the context of sustainable chemistry.
Formula:C9H16O3
InChI:InChI=1S/C9H16O3/c1-3-4-7-12-9(11)6-5-8(2)10/h3-7H2,1-2H3
InChI key:InChIKey=ISBWNEKJSSLXOD-UHFFFAOYSA-N
SMILES:C(CCC(C)=O)(OCCCC)=O
Synonyms:- 2,4,5-Trimethoxyamphetamine Hydrochloride
- 4-Ketopentanoic acid butyl ester
- Butyl 4-Oxopentanoate
- Levulinic acid n-butyl ester
- Levulinic acid, butyl ester
- N-Butyl 4-Oxopentanoate
- NSC 78451
- Pentanoic acid, 4-oxo-, butyl ester
- n-Butyl levulinate
- Butyl levulinate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Butyl Levulinate
CAS:Formula:C9H16O3Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:172.22n-Butyl levulinate, 98%
CAS:Butyl levulinate was used in the synthesis of -valerolactone. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference hFormula:C9H16O3Purity:98%Molecular weight:172.22Pentanoic acid, 4-oxo-, butyl ester
CAS:Formula:C9H16O3Purity:98%Color and Shape:LiquidMolecular weight:172.2215Butyl levulinate
CAS:Butyl levulinate is a levulinic acid ester. It is a reaction solution that can catalyze the esterification of levulinic acid and butanol or furfuryl alcohol to produce butyl levulinate. The catalyst for this reaction is typically an acidic substance, such as sulfuric acid, hydrochloric acid, or phosphoric acid. Catalysts are used to promote the reaction. Furfuryl alcohol is typically used as the reactant because it has a higher boiling point than butanol, which makes it easier to work with in the laboratory. Butyl levulinate can be used in biomass conversion to produce fuel and other products.
Formula:C9H16O3Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:172.22 g/mol





