CAS 20520-37-0
:sodium (2S,5R,6R)-6-{[(5-bromofuran-2-yl)carbonyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate
Description:
The chemical substance known as sodium (2S,5R,6R)-6-{[(5-bromofuran-2-yl)carbonyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate, with CAS number 20520-37-0, is a complex organic compound that features a bicyclic structure containing both sulfur and nitrogen atoms. This compound is characterized by its thiazolidine ring, which contributes to its unique chemical properties. The presence of a bromofuran moiety indicates potential reactivity and biological activity, often associated with antimicrobial properties. The carboxylate group suggests that it can exist as a salt, enhancing its solubility in aqueous environments. Additionally, the stereochemistry indicated by the (2S,5R,6R) configuration implies specific spatial arrangements of its substituents, which can significantly influence its biological interactions and pharmacological profile. Overall, this compound's intricate structure and functional groups suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents.
Formula:C13H12BrN2NaO5S
InChI:InChI=1/C13H13BrN2O5S.Na/c1-13(2)8(12(19)20)16-10(18)7(11(16)22-13)15-9(17)5-3-4-6(14)21-5;/h3-4,7-8,11H,1-2H3,(H,15,17)(H,19,20);/q;+1/p-1/t7-,8+,11-;/m1./s1
SMILES:CC1(C)C(C(=O)O)N2C(=O)C(C2S1)NC(=O)c1ccc(Br)o1.[Na]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
