CymitQuimica logo

CAS 205242-62-2

:

(+)-2(R)-[3-(Morpholin-4-ylmethyl)-2H-1-benzopyran-8-yloxymethyl]morpholine methanesulfonate

Description:
The chemical substance known as "(+)-2(R)-[3-(Morpholin-4-ylmethyl)-2H-1-benzopyran-8-yloxymethyl]morpholine methanesulfonate," with the CAS number 205242-62-2, is a complex organic compound characterized by its unique structural features. It contains a benzopyran moiety, which is a fused ring system known for its presence in various natural products and pharmaceuticals. The morpholine groups in its structure suggest potential interactions with biological targets, making it of interest in medicinal chemistry. The methanesulfonate moiety indicates that it is a salt, which can enhance its solubility and stability in aqueous environments. This compound is likely to exhibit specific stereochemical properties due to its chiral centers, influencing its biological activity and pharmacokinetics. Overall, its intricate structure and functional groups suggest potential applications in drug development, particularly in targeting specific receptors or enzymes in biological systems. Further studies would be necessary to elucidate its precise biological effects and therapeutic potential.
Formula:C21H34N2O10S2
InChI:InChI=1/C19H26N2O4.2CH4O3S/c1-2-16-10-15(12-21-5-8-22-9-6-21)13-25-19(16)18(3-1)24-14-17-11-20-4-7-23-17;2*1-5(2,3)4/h1-3,10,17,20H,4-9,11-14H2;2*1H3,(H,2,3,4)/t17-;;/m1../s1
SMILES:c1cc2C=C(CN3CCOCC3)COc2c(c1)OC[C@H]1CNCCO1.CS(=O)(=O)O.CS(=O)(=O)O
Synonyms:
  • Nas-181
  • 4-[[8-[[(2R)-morpholin-2-yl]methoxy]-2H-chromen-3-yl]methyl]morpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.