CAS 2053-21-6
:Benzoic acid, 3,4,5-trihydroxy-, sodium salt (1:1)
Description:
Benzoic acid, 3,4,5-trihydroxy-, sodium salt (1:1), commonly known as sodium 3,4,5-trihydroxybenzoate, is a sodium salt derived from benzoic acid with three hydroxyl groups positioned at the 3, 4, and 5 carbon atoms of the aromatic ring. This compound is characterized by its white to off-white crystalline appearance and is soluble in water, which enhances its utility in various applications. It exhibits antioxidant properties due to the presence of hydroxyl groups, making it valuable in food preservation and cosmetic formulations. The compound is also known for its potential health benefits, including anti-inflammatory and antimicrobial activities. In terms of stability, it is generally stable under normal conditions but should be stored away from strong oxidizing agents. Its chemical structure allows it to participate in various chemical reactions, making it a versatile compound in both industrial and laboratory settings. As with any chemical substance, proper handling and safety precautions should be observed to mitigate any potential risks associated with its use.
Formula:C7H6O5·Na
InChI:InChI=1S/C7H6O5.Na/c8-4-1-3(7(11)12)2-5(9)6(4)10;/h1-2,8-10H,(H,11,12);
InChI key:InChIKey=XQPWJRZWRQRVMT-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(O)=C(O)C(O)=C1.[Na]
Synonyms:- Benzoic acid, 3,4,5-trihydroxy-, monosodium salt
- Benzoic acid, 3,4,5-trihydroxy-, sodium salt (1:1)
- Gallic acid, monosodium salt
- Gallic acid, sodium salt
- Sodium 3,4,5-Trihydroxybenzoate
- Sodium gallate
- Sodium gallate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzoic acid, 3,4,5-trihydroxy-, sodium salt (1:1)
CAS:Formula:C7H5NaO5Purity:98%Molecular weight:192.1014Gallic acid sodium
CAS:<p>Gallic acid sodium salt is a fatty acid that can be extracted from plant sources. It is a hydroxyl group with a cationic surfactant and it has high values in the hydroxide solution. Gallic acid sodium salt can be used as a hydroxyl group extractant, which is an important property for use in clinical settings. It also has high values as a radiation-resistant, hydroxide solution, and hydroxyapatite extractant. The compound can be prepared by treating gallic acid with sodium carbonate or sodium hydroxide to form gallium(III) ion and sodium chloride. This compound can then react with copper chloride to form gallium(III) copper chloride coordination complex.</p>Formula:C7H5O5NaPurity:Min. 95%Color and Shape:PowderMolecular weight:192.1 g/mol
