
CAS 205304-87-6
:Tubulysin B
Description:
Tubulysin B is a natural product belonging to a class of compounds known as tubulysins, which are derived from the myxobacterium *Archangium gephyra*. This compound is characterized by its potent antitumor activity, primarily through its ability to inhibit microtubule polymerization, thereby disrupting the normal function of the mitotic spindle during cell division. Tubulysin B exhibits a complex structure featuring a unique bicyclic core, which contributes to its biological activity. It is known for its high selectivity towards cancer cells, making it a subject of interest in cancer research and drug development. Additionally, Tubulysin B has shown promise in overcoming resistance mechanisms that some cancer cells develop against conventional chemotherapeutics. Its solubility and stability in various solvents are also important characteristics that influence its potential therapeutic applications. Ongoing studies aim to explore its efficacy, optimize its pharmacological properties, and assess its safety profile for potential clinical use.
Formula:C42H63N5O10S
InChI:InChI=1S/C42H63N5O10S/c1-9-13-36(50)56-24-47(41(53)37(26(5)10-2)45-39(52)33-14-11-12-19-46(33)8)34(25(3)4)22-35(57-28(7)48)40-44-32(23-58-40)38(51)43-30(20-27(6)42(54)55)21-29-15-17-31(49)18-16-29/h15-18,23,25-27,30,33-35,37,49H,9-14,19-22,24H2,1-8H3,(H,43,51)(H,45,52)(H,54,55)/t26-,27-,30+,33+,34+,35+,37-/m0/s1
InChI key:InChIKey=HWCIETDQUHYHGQ-YHVCZDCZSA-N
SMILES:[C@H](C[C@@H](N(C([C@@H](NC(=O)[C@@H]1N(C)CCCC1)[C@H](CC)C)=O)COC(CCC)=O)[C@H](C)C)(OC(C)=O)C2=NC(C(N[C@@H](CC3=CC=C(O)C=C3)C[C@@H](C(O)=O)C)=O)=CS2
Synonyms:- Tubulysin B
- Benzenepentanoic acid, γ-[[[2-[(1R,3R)-1-(acetyloxy)-4-methyl-3-[[(2S,3S)-3-methyl-2-[[[(2R)-1-methyl-2-piperidinyl]carbonyl]amino]-1-oxopentyl][(1-oxobutoxy)methyl]amino]pentyl]-4-thiazolyl]carbonyl]amino]-4-hydroxy-α-methyl-, (αS,γR)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Tubulysin B
CAS:Tubulysin B: a potent, cytotoxic microtubule-disrupting peptide from Archangium geophyra and Angiococcus disciformis.Formula:C42H63N5O10SPurity:98%Color and Shape:SolidMolecular weight:830.04Tubulysin B
CAS:<p>Tubulysin B is a peptide that inhibits the interaction of proteins with their ligands. It has been shown to act as an inhibitor of protein interactions, specifically acting on ion channels and receptors. Tubulysin B has also been shown to be an activator of Ligands, which are compounds that bind to receptors. Tubulysin B can be used in research for studying the effects of drugs on cells and for identifying the ligands that bind to specific receptors. It is also used in life science research for studying the function of proteins, such as ion channels and receptor-ligand interactions. This compound is available in high purity and has a CAS number 205304-87-6.</p>Formula:C42H63N5O10SPurity:Min. 95%Molecular weight:830 g/mol


