CymitQuimica logo

CAS 205318-52-1

:

tert-butyl [3-(aminomethyl)phenyl]carbamate

Description:
Tert-butyl [3-(aminomethyl)phenyl]carbamate is an organic compound characterized by its carbamate functional group, which is derived from the reaction of an amine and a carbonic acid derivative. This compound features a tert-butyl group, providing steric hindrance that can influence its reactivity and solubility. The presence of the aminomethyl group attached to a phenyl ring suggests potential for hydrogen bonding and interactions with biological systems, making it of interest in medicinal chemistry. The molecular structure indicates that it may exhibit properties such as moderate polarity, which can affect its solubility in various solvents. Additionally, the compound may have applications in drug development or as a building block in organic synthesis due to its functional groups. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure. Overall, tert-butyl [3-(aminomethyl)phenyl]carbamate represents a versatile compound with potential applications in various fields of chemistry and pharmacology.
Formula:C12H18N2O2
InChI:InChI=1/C12H18N2O2/c1-12(2,3)16-11(15)14-10-6-4-5-9(7-10)8-13/h4-7H,8,13H2,1-3H3,(H,14,15)
InChI key:NXQNEOIMZVWHQW-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=Nc1cccc(c1)CN)O
Synonyms:
  • Carbamic acid, N-[3-(aminomethyl)phenyl]-, 1,1-dimethylethyl ester
  • tert-Butyl [3-(aminomethyl)phenyl]carbamate
Found 4 products.