CAS 205319-06-8
:Dichloro[bis(diphenylphosphinophenyl)ether]palladium(II)
Description:
Dichloro[bis(diphenylphosphinophenyl)ether]palladium(II) is a coordination compound featuring a palladium center coordinated to two diphenylphosphine ligands and two chloride ions. This compound is characterized by its palladium(II) oxidation state, which is common in various palladium complexes, allowing it to participate in catalytic processes, particularly in cross-coupling reactions such as Suzuki and Heck reactions. The presence of diphenylphosphine ligands enhances its stability and solubility in organic solvents, making it suitable for various synthetic applications. The diphenylphosphinophenyl ether moieties contribute to the steric and electronic properties of the complex, influencing its reactivity and selectivity in catalysis. Additionally, the compound's structure can be analyzed using techniques such as NMR and X-ray crystallography, providing insights into its geometric configuration and bonding characteristics. Overall, this palladium complex is significant in organometallic chemistry and catalysis, showcasing the versatility of palladium in forming stable complexes with phosphine ligands.
Formula:C36H28Cl2OP2Pd
InChI:InChI=1/C36H28OP2.2ClH.Pd/c1-5-17-29(18-6-1)38(30-19-7-2-8-20-30)35-27-15-13-25-33(35)37-34-26-14-16-28-36(34)39(31-21-9-3-10-22-31)32-23-11-4-12-24-32;;;/h1-28H;2*1H;/q;;;+2/p-2
SMILES:c1ccc(cc1)P(c1ccccc1)c1ccccc1Oc1ccccc1P(c1ccccc1)c1ccccc1.Cl.Cl.[Pd]
Synonyms:- (Oxydibenzene-2,1-Diyl)Bis(Diphenylphosphane) - Dichloropalladium (1:1)
- Bis(diphenylphosphinophenyl)ether palladium (II) dichloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Dichloro[bis(diphenylphosphinophenyl)ether]palladium(II), Pd 13% min
CAS:Dichloro[bis(diphenylphosphinophenyl)ether]palladium(II) is used as a catalyst for cross-coupling reaction of 2-brom-1,3-dienes to prepare high stereoselectivity of conjugated Z,E dienes. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some doc
Formula:C36H28Cl2OP2PdMolecular weight:715.89Dichloro{bis[2-(diphenylphosphino)phenyl]ether}palladium(II), 98%
CAS:Dichloro{bis[2-(diphenylphosphino)phenyl]ether}palladium(II), 98%
Formula:C36H28Cl2OP2PdPurity:98%Color and Shape:yellow pwdr.Molecular weight:715.88Palladium, dichloro[1,1'-(oxydi-2,1-phenylene)bis[1,1-diphenylphosphine-κP]]-, (SP-4-2)-
CAS:Formula:C36H28Cl2OP2PdPurity:97%Color and Shape:SolidMolecular weight:715.8804Dichloro[bis(2-(diphenylphosphino)phenyl)ether]palladium(II)
CAS:Dichloro[bis(2-(diphenylphosphino)phenyl)ether]palladium(II)Purity:98%Color and Shape:PowderMolecular weight:715.88g/molDichloro[bis(2-(diphenylphosphino)phenyl)ether]palladium(II)
CAS:Controlled ProductPlease enquire for more information about Dichloro[bis(2-(diphenylphosphino)phenyl)ether]palladium(II) including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C36H28Cl2OP2PdPurity:Min. 95%Molecular weight:715.88 g/mol





