CAS 20532-05-2

4-methyl-3-sulfamoylbenzoate

Description:

4-Methyl-3-sulfamoylbenzoate, with the CAS number 20532-05-2, is an organic compound characterized by its sulfonamide functional group and a benzoate moiety. This compound typically appears as a crystalline solid and is soluble in polar solvents, reflecting its polar functional groups. The presence of the sulfonamide group imparts specific biological activity, often associated with antibacterial properties, making it of interest in medicinal chemistry. The methyl group at the para position relative to the sulfonamide enhances its lipophilicity, potentially influencing its pharmacokinetic properties. Additionally, the benzoate structure contributes to its stability and reactivity, allowing for various chemical modifications. The compound's synthesis usually involves the reaction of a benzoic acid derivative with a sulfonamide reagent, followed by esterification. Overall, 4-methyl-3-sulfamoylbenzoate exemplifies the intersection of organic chemistry and pharmacology, showcasing the importance of functional group positioning in determining the properties and applications of chemical substances.

Formula: C₈H₉NO₄S

InChI: InChI=1/C8H9NO4S/c1-5-2-3-6(8(10)11)4-7(5)14(9,12)13/h2-4H,1H3,(H,10,11)(H2,9,12,13)

SMILES: Cc1ccc(cc1S(=O)(=O)N)C(=O)O

Synonyms:

• 3-(Aminosulfonyl)-4-Methylbenzoic Acid
• Benzoic acid, 3-(aminosulfonyl)-4-methyl-
• 4-Methyl-3-sulfamoylbenzoic acid
• 4-methyl-3-sulfamoylbenzoate

Benzoic acid, 3-(aminosulfonyl)-4-methyl-

CAS: 20532-05-2

Formula: C₈H₉NO₄S

Purity: 97%

Color and Shape: Solid

Molecular weight: 215.2264

Ref: IN-DA002A0R

4-Methyl-3-sulfamoylbenzoic acid

CAS: 20532-05-2

4-Methyl-3-sulfamoylbenzoic acid

Purity: 97%

Molecular weight: 215.23g/mol

Ref: 54-OR1036188

4-Methyl-3-sulfamoylbenzoic acid

CAS: 20532-05-2

Formula: C₈H₉NO₄S

Purity: 97%

Color and Shape: Solid

Molecular weight: 215.22

Ref: 10-F015561

4-Methyl-3-sulfamoylbenzoic acid

CAS: 20532-05-2

Versatile small molecule scaffold

Formula: C₈H₉NO₄S

Purity: Min. 95%

Molecular weight: 215.23 g/mol

Ref: 3D-VAA53205