CAS 20532-06-3
:4-methoxy-3-sulfamoylbenzoate
Description:
4-Methoxy-3-sulfamoylbenzoate, identified by its CAS number 20532-06-3, is an organic compound characterized by the presence of a benzoate structure substituted with a methoxy group and a sulfonamide moiety. This compound typically exhibits a white to off-white crystalline appearance. The methoxy group contributes to its solubility in organic solvents, while the sulfonamide group can enhance its reactivity and potential biological activity. The presence of both functional groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, compounds with sulfonamide groups are often studied for their pharmacological properties, including antibacterial and diuretic effects. The compound's molecular structure indicates potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature. Proper handling and storage conditions are essential to maintain its integrity and efficacy in research or application settings.
Formula:C8H8NO5S
InChI:InChI=1/C8H9NO5S/c1-14-6-3-2-5(8(10)11)4-7(6)15(9,12)13/h2-4H,1H3,(H,10,11)(H2,9,12,13)/p-1
SMILES:COc1ccc(cc1S(=O)(=O)N)C(=O)O
Synonyms:- 3-(Aminosulfonyl)-4-Methoxybenzoic Acid
- Benzoic Acid, 3-(Aminosulfonyl)-4-Methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(Aminosulfonyl)-4-methoxybenzoic acid
CAS:Formula:C8H9NO5SPurity:97%Color and Shape:SolidMolecular weight:231.22584-Methoxy-3-sulfamoylbenzoic acid
CAS:<p>4-Methoxy-3-sulfamoylbenzoic acid</p>Purity:97%Molecular weight:231.23g/mol4-Methoxy-3-sulfamoylbenzoic acid
CAS:<p>Please enquire for more information about 4-Methoxy-3-sulfamoylbenzoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C8H9NO5SPurity:Min. 95%Molecular weight:231.23 g/mol



