CAS 20532-30-3
:5-Methoxybenzo[b]thiophene
Description:
5-Methoxybenzo[b]thiophene is an organic compound characterized by its fused ring structure, which includes a benzene ring and a thiophene ring. The presence of a methoxy group (-OCH3) at the 5-position of the benzo[b]thiophene framework contributes to its chemical properties, influencing its reactivity and solubility. This compound typically exhibits a yellow to brown color and is known for its aromatic characteristics, which can lead to interesting electronic properties. It is often studied for its potential applications in organic electronics, such as in organic light-emitting diodes (OLEDs) and organic photovoltaics, due to its ability to facilitate charge transport. Additionally, 5-Methoxybenzo[b]thiophene may exhibit biological activity, making it of interest in medicinal chemistry. Its synthesis generally involves methods that introduce the methoxy group onto the benzo[b]thiophene core, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity.
Formula:C9H8OS
InChI:InChI=1S/C9H8OS/c1-10-8-2-3-9-7(6-8)4-5-11-9/h2-6H,1H3
InChI key:InChIKey=YUCSRVKBVKJMNH-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C(=CC1)SC=C2
Synonyms:- 1-Benzothiophen-5-yl methyl ether
- 5-Methoxy-1-Benzothiophene
- 5-Methoxybenzo[B]Thiophene
- Benzo[B]Thiophene, 5-Methoxy-
- 5-Methoxybenzothiophene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzo[b]thiophene, 5-methoxy-
CAS:Formula:C9H8OSPurity:95%Color and Shape:SolidMolecular weight:164.22425-Methoxy-benzo[b]thiophene
CAS:5-Methoxy-benzo[b]thiophene is a synthetic compound that has been shown to have antiestrogenic activity. It was synthesized using the acetonitrile technique and has been shown to inhibit the growth of mammary carcinomas in mice. 5-Methoxy-benzo[b]thiophene binds to estrogen receptor protein, which inhibits the binding of estrogen and prevents its effects on breast cancers. This agent also has been shown to be an effective therapy for some human breast cancer cells, which may be due to its ability to block estrogen receptor function.
Formula:C9H8OSPurity:Min. 95%Molecular weight:164.22 g/molRef: 3D-VAA53230
Discontinued product



