CAS 20532-34-7

1-Benzothiophen-5-ylmethanol

Description:

1-Benzothiophen-5-ylmethanol, with the CAS number 20532-34-7, is an organic compound characterized by its unique structure that combines a benzothiophene moiety with a hydroxymethyl group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It features a benzothiophene ring, which is a fused bicyclic structure containing both benzene and thiophene, contributing to its aromatic properties and potential for various chemical reactivity. The hydroxymethyl group (-CH2OH) introduces a functional site that can participate in further chemical reactions, such as oxidation or etherification. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and material science. Its solubility can vary based on the solvent used, and it may show varying degrees of stability under different environmental conditions. Overall, 1-benzothiophen-5-ylmethanol is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₉H₈OS

InChI: InChI=1/C9H8OS/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5,10H,6H2

SMILES: c1cc2c(ccs2)cc1CO

Benzo[b]thiophene-5-methanol

CAS: 20532-34-7

Formula: C₉H₈OS

Purity: 96%

Color and Shape: Solid

Molecular weight: 164.2242

Ref: IN-DA002A0L

5-(Hydroxymethyl)benzo[b]thiophene

CAS: 20532-34-7

5-(Hydroxymethyl)benzo[b]thiophene

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 164.22g/mol

Ref: 54-OR400946

1-BENZOTHIOPHEN-5-YLMETHANOL

CAS: 20532-34-7

Formula: C₉H₈OS

Purity: 96%

Color and Shape: Solid

Molecular weight: 164.22

Ref: 10-F501798

1-Benzothien-5-ylmethanol

CAS: 20532-34-7

Versatile small molecule scaffold

Formula: C₉H₈OS

Purity: Min. 95%

Molecular weight: 164.23 g/mol

Ref: 3D-VAA53234