
CAS 20532-39-2: Methyl benzo[b]thiophene-5-carboxylate
Description:Methyl benzo[b]thiophene-5-carboxylate is an organic compound characterized by its unique structure, which includes a benzo[b]thiophene ring fused with a carboxylate group. This compound typically exhibits a molecular formula that reflects the presence of carbon, hydrogen, and oxygen atoms, contributing to its aromatic and heterocyclic properties. Methyl benzo[b]thiophene-5-carboxylate is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the methyl ester functional group enhances its reactivity, making it suitable for further chemical transformations. Additionally, this compound may exhibit specific physical properties such as solubility in organic solvents and distinct spectral characteristics in techniques like NMR and IR spectroscopy. Its stability and reactivity can vary depending on the conditions, such as temperature and the presence of catalysts. Overall, methyl benzo[b]thiophene-5-carboxylate is a valuable compound in the field of organic chemistry, with implications for research and industrial applications.
Formula:C10H8O2S
InChI:InChI=1S/C10H8O2S/c1-12-10(11)8-2-3-9-7(6-8)4-5-13-9/h2-6H,1H3
InChI key:InChIKey=XCDQIUIOQIOHFF-UHFFFAOYSA-N
SMILES:O=C(OC)C=1C=CC=2SC=CC2C1
- Synonyms:
- Benzo[b]thiophene-5-carboxylic acid, methyl ester
- 1-Benzothiophene-5-carboxylic acid methyl ester
- Methyl benzo[b]thiophene-5-carboxylate

Ref: 10-F614317
1g | 150.00 € | ||
5g | 505.00 € | ||
100mg | 23.00 € | ||
250mg | 54.00 € |

Benzo[b]thiophene-5-carboxylic acid, methyl ester
Ref: IN-DA01JQS9
1g | 193.00 € | ||
5g | 499.00 € | ||
100mg | 53.00 € | ||
250mg | 81.00 € |

Ref: 54-OR81375
1g | 380.00 € | ||
100mg | 100.00 € | ||
250mg | 111.00 € |

Benzo[b]thiophene-5-carboxylic acid, methyl ester
Ref: 3D-VAA53239
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |