CAS 20535-58-4
:5-(3,4-dichlorophenyl)-6-(ethoxymethyl)pyrimidine-2,4-diamine
Description:
5-(3,4-Dichlorophenyl)-6-(ethoxymethyl)pyrimidine-2,4-diamine, with the CAS number 20535-58-4, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring substituted at the 2 and 4 positions with amino groups, which enhances its potential for biological activity. The presence of a 3,4-dichlorophenyl group at the 5 position contributes to its lipophilicity and may influence its interaction with biological targets. Additionally, the ethoxymethyl group at the 6 position can affect the compound's solubility and stability. This compound is of interest in medicinal chemistry, particularly for its potential applications in pharmaceuticals, as many pyrimidine derivatives exhibit antitumor, antiviral, and anti-inflammatory properties. Its synthesis and characterization typically involve standard organic chemistry techniques, and its properties can be further explored through various analytical methods such as NMR, mass spectrometry, and chromatography. Safety and handling precautions should be observed due to the presence of halogenated compounds, which may pose environmental and health risks.
Formula:C13H14Cl2N4O
InChI:InChI=1/C13H14Cl2N4O/c1-2-20-6-10-11(12(16)19-13(17)18-10)7-3-4-8(14)9(15)5-7/h3-5H,2,6H2,1H3,(H4,16,17,18,19)
SMILES:CCOCc1c(c2ccc(c(c2)Cl)Cl)c(=N)[nH]c(=N)[nH]1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,4-Pyrimidinediamine, 5-(3,4-dichlorophenyl)-6-(ethoxymethyl)-
CAS:Formula:C13H14Cl2N4OMolecular weight:313.18255-(3,4-Dichlorophenyl)-6-(ethoxymethyl)pyrimidine-2,4-diamine
CAS:Controlled ProductFormula:C13H14Cl2N4OColor and Shape:NeatMolecular weight:313.18

