CAS 205383-87-5

tert-butyl 2-oxo-1,2-dihydro-1'H-spiro[indole-3,3'-pyrrolidine]-1'-carboxylate

Description:

Tert-butyl 2-oxo-1,2-dihydro-1'H-spiro[indole-3,3'-pyrrolidine]-1'-carboxylate is a complex organic compound characterized by its spirocyclic structure, which incorporates both indole and pyrrolidine moieties. This compound features a tert-butyl ester functional group, contributing to its solubility and stability in organic solvents. The presence of the 2-oxo group indicates that it has a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic additions. The spiro structure suggests unique stereochemical properties, potentially influencing its biological activity. This compound may exhibit interesting pharmacological properties due to the indole and pyrrolidine components, which are often associated with various biological activities. Its CAS number, 205383-87-5, allows for easy identification in chemical databases. Overall, this substance is of interest in medicinal chemistry and may serve as a lead compound for further research and development in drug discovery.

Formula: C₁₆H₂₀N₂O₃

InChI: InChI=1/C16H20N2O3/c1-15(2,3)21-14(20)18-9-8-16(10-18)11-6-4-5-7-12(11)17-13(16)19/h4-7H,8-10H2,1-3H3,(H,17,19)

SMILES: CC(C)(C)OC(=O)N1CCC2(C1)c1ccccc1N=C2O

2-Oxo-1,2-dihydro-spiro[indole-3,3'-pyrrolidine]-1'-carboxylic acid tert-butyl ester

CAS: 205383-87-5

Formula: C₁₆H₂₀N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 288.3416

Ref: IN-DA002A1H

tert-Butyl 2-oxospiro[indoline-3,3'-pyrrolidine]-1'-carboxylate

CAS: 205383-87-5

tert-Butyl 2-oxospiro[indoline-3,3'-pyrrolidine]-1'-carboxylate

Purity: 98%

Molecular weight: 288.34g/mol

Ref: 54-OR92126

Tert-Butyl 2-oxospiro[indoline-3,3'-pyrrolidine]-1'-carboxylate

CAS: 205383-87-5

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 288.34698486328125

Ref: 10-F077837