CAS 2054345-68-3

1-(1,1-Dimethylethyl) (3R)-13-azido-3-carboxy-5,8,11-trioxa-2-azatridecanoate

Description:

1-(1,1-Dimethylethyl) (3R)-13-azido-3-carboxy-5,8,11-trioxa-2-azatridecanoate, identified by its CAS number 2054345-68-3, is a complex organic compound characterized by its unique functional groups and structural features. This substance contains an azido group, which is known for its reactivity and potential applications in click chemistry and bioconjugation. The presence of multiple ether linkages (trioxa) suggests that it may exhibit interesting solubility properties and could participate in various chemical reactions. The carboxylic acid functionality indicates potential for forming salts or esters, enhancing its versatility in synthetic applications. The tert-butyl group (1,1-dimethylethyl) contributes to steric hindrance, which may influence the compound's reactivity and interactions with biological systems. Overall, this compound's structure suggests potential utility in medicinal chemistry, materials science, or as a building block in organic synthesis, although specific applications would depend on further research and characterization.

Formula: C₁₄H₂₆N₄O₇

InChI: InChI=1S/C14H26N4O7/c1-14(2,3)25-13(21)17-11(12(19)20)10-24-9-8-23-7-6-22-5-4-16-18-15/h11H,4-10H2,1-3H3,(H,17,21)(H,19,20)/t11-/m1/s1

InChI key: InChIKey=NYDWDSHNHZCWMW-LLVKDONJSA-N

SMILES: [C@@H](NC(OC(C)(C)C)=O)(COCCOCCOCCN=[N+]=[N-])C(O)=O

Synonyms:

• 1-(1,1-Dimethylethyl) (3R)-13-azido-3-carboxy-5,8,11-trioxa-2-azatridecanoate
• 5,8,11-Trioxa-2-azatridecanoic acid, 13-azido-3-carboxy-, 1-(1,1-dimethylethyl) ester, (3R)-

Azido-PEG3-Ala-Boc

CAS: 2054345-68-3

Azido-PEG3-Ala-Boc is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₁₄H₂₆N₄O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 362.38

Ref: TM-T14423