
CAS 205437-62-3
:Benzeneethan-α,β,β-d3-amine, α-(methyl-d3)-, hydrochloride, (αS)-
Description:
Benzeneethan-α,β,β-d3-amine, α-(methyl-d3)-, hydrochloride, (αS)- is a deuterated compound, which means it contains deuterium, a stable isotope of hydrogen. This compound features a benzene ring attached to an ethylamine structure, with specific deuterium labeling at the α and β positions, indicating the presence of three deuterium atoms. The hydrochloride designation indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications in research and pharmaceuticals. The (αS)- notation suggests that the compound has a specific stereochemistry, which can influence its biological activity and interactions. Deuterated compounds like this one are often used in studies involving metabolic pathways, drug development, and NMR spectroscopy, as the presence of deuterium can provide insights into molecular dynamics and interactions. Overall, this compound is significant in both synthetic chemistry and biological research due to its unique isotopic labeling and structural characteristics.
Formula:C9H7D6N·ClH
InChI:InChI=1S/C9H13N.ClH/c1-8(10)7-9-5-3-2-4-6-9;/h2-6,8H,7,10H2,1H3;1H/t8-;/m0./s1/i1D3,7D2,8D;
InChI key:InChIKey=SEVKYLYIYIKRSW-VMEYXNQBSA-N
SMILES:C([C@](C([2H])([2H])[2H])(N)[2H])(C1=CC=CC=C1)([2H])[2H].Cl
Synonyms:- Benzeneethan-α,β,β-d3-amine, α-(methyl-d3)-, hydrochloride, (S)-
- Benzeneethan-α,β,β-d3-amine, α-(methyl-d3)-, hydrochloride, (αS)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dexamfetamine-D6 Hydrochloride (~94 : 6 e.r.)
CAS:Controlled ProductFormula:C9H7D6N•HClColor and Shape:NeatMolecular weight:141.243646
