CAS 205448-31-3
:4-Chloro-6-methoxy-quinolin-7-ol
Description:
4-Chloro-6-methoxy-quinolin-7-ol is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro group at the 4-position and a methoxy group at the 6-position, along with a hydroxyl group at the 7-position of the quinoline ring. These functional groups contribute to its chemical reactivity and potential biological activity. The presence of the hydroxyl group suggests that it may exhibit properties typical of phenolic compounds, such as antioxidant activity. The chloro and methoxy substituents can influence the compound's solubility, stability, and interaction with biological targets. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could be linked to various biological activities. Additionally, its CAS number, 205448-31-3, allows for easy identification and reference in chemical databases and literature.
Formula:C10H8ClNO2
InChI:InChI=1S/C10H8ClNO2/c1-14-10-4-6-7(11)2-3-12-8(6)5-9(10)13/h2-5,13H,1H3
SMILES:COc1cc2c(ccnc2cc1O)Cl
Synonyms:- 7-Quinolinol, 4-chloro-6-methoxy-
- 4-Chloro-6-methoxyquinolin-7-ol
- 4-Chloro-7-hydroxy-6-methoxy-7-quinoline
- 4-Chloro-6-methoxy-7-quinolinol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7-Quinolinol, 4-chloro-6-methoxy-
CAS:Formula:C10H8ClNO2Purity:98%Color and Shape:SolidMolecular weight:209.6290Ref: IN-DA002A2X
1g63.00€5g112.00€10g154.00€1kgTo inquire25g251.00€250gTo inquire500gTo inquire100mg28.00€250mg28.00€4-Chloro-6-methoxyquinolin-7-ol
CAS:4-Chloro-6-methoxyquinolin-7-olFormula:C10H8ClNO2Purity:98%Color and Shape: white to light brown solidMolecular weight:209.63g/mol4-Chloro-6-methoxyquinolin-7-ol
CAS:4-Chloro-6-methoxyquinolin-7-ol (CMQ) is an alkali metal that inhibits the sodium/potassium ATPase pump, which is responsible for maintaining the cell's intracellular ion balance. It was discovered in a search for compounds that inhibit this enzyme and show promise in the treatment of heart diseases. CMQ has been shown to inhibit the sodium concentration in rat hearts with no effect on potassium concentrations, which may be due to its ability to bind to sodium ions but not potassium ions. The long-term effects of CMQ on human populations are unknown, as well as its effects on genotype and parameters. CMQ also has been shown to cause drug resistance mutations in bacteria, such as methicillin resistant Staphylococcus aureus (MRSA), by increasing the mutation rate. This is due to the fact that it inhibits DNA replication and protein synthesis in bacteria cells.Formula:C10H8ClNO2Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:209.63 g/mol4-Chloro-6-methoxyquinolin-7-ol
CAS:Formula:C10H8ClNO2Purity:98%Color and Shape:Solid, Yellow powderMolecular weight:209.63




