CAS 20546-32-1
:N-(Hydroxymethyl)-N-methylformamide
Description:
N-(Hydroxymethyl)-N-methylformamide, with the CAS number 20546-32-1, is an organic compound characterized by its amide functional group. It features a hydroxymethyl group (-CH2OH) and a methyl group (-CH3) attached to the nitrogen atom, which contributes to its unique properties. This compound is typically a colorless to pale yellow liquid and is soluble in water and various organic solvents, making it versatile in chemical applications. It has a relatively low boiling point and moderate viscosity, which can influence its behavior in reactions. N-(Hydroxymethyl)-N-methylformamide is often used as a reagent in organic synthesis, particularly in the preparation of other chemical compounds. Its structure allows it to participate in hydrogen bonding, which can affect its reactivity and interactions with other substances. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, this compound is significant in both industrial and laboratory settings due to its reactivity and solubility characteristics.
Formula:C3H7NO2
InChI:InChI=1/C3H7NO2/c1-4(2-5)3-6/h2,6H,3H2,1H3
InChI key:InChIKey=KOCFTADHOAAXFC-UHFFFAOYSA-N
SMILES:N(CO)(C=O)C
Synonyms:- N-Methyl-N-methylolformamide
- formamide, N-(hydroxymethyl)-N-methyl-
- N-(Hydroxymethyl)-N-methylformamide
- N-(Hydroxymethyl)-N-methylformamide
- HMMF
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
