CAS 205495-66-5
:(1S,2S)-(-)-1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-naphthoyl)
Description:
(1S,2S)-(-)-1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-naphthoyl) is a chiral ligand commonly used in asymmetric synthesis and catalysis. This compound features a cyclohexane backbone with two amine groups at the 1 and 2 positions, contributing to its ability to form stable complexes with transition metals. The presence of two diphenylphosphino groups enhances its coordination properties, making it effective in facilitating various catalytic reactions, particularly in the formation of carbon-carbon bonds. The naphthoyl moieties provide additional steric and electronic effects, which can influence the selectivity and reactivity of the metal-ligand complex. This ligand is typically characterized by its ability to form chelate complexes, which can stabilize metal centers and improve catalytic efficiency. Its chirality allows for the potential to induce asymmetry in reactions, making it valuable in the synthesis of enantiomerically pure compounds. Overall, this compound exemplifies the intersection of organic chemistry and coordination chemistry, showcasing the importance of ligand design in catalysis.
Formula:C52H44N2O2P2
InChI:InChI=1/C52H44N2O2P2/c55-51(49-43-29-15-13-19-37(43)33-35-47(49)57(39-21-5-1-6-22-39)40-23-7-2-8-24-40)53-45-31-17-18-32-46(45)54-52(56)50-44-30-16-14-20-38(44)34-36-48(50)58(41-25-9-3-10-26-41)42-27-11-4-12-28-42/h1-16,19-30,33-36,45-46H,17-18,31-32H2,(H,53,55)(H,54,56)/t45-,46-/m0/s1
SMILES:c1ccc(cc1)P(c1ccccc1)c1ccc2ccccc2c1C(=N[C@H]1CCCC[C@@H]1N=C(c1c2ccccc2ccc1P(c1ccccc1)c1ccccc1)O)O
Synonyms:- N,N'-(1S,2S)-cyclohexane-1,2-diylbis[2-(diphenylphosphanyl)naphthalene-1-carboxamide]
- (S,S)-DACH-Naphthyl Trost Ligand
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(1S,2S)-(-)-1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-naphthoyl), min. 94% (S,S)-DACH-Naphthyl Trost Ligand
CAS:(1S,2S)-(-)-1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-naphthoyl), min. 94% (S,S)-DACH-Naphthyl Trost Ligand
Formula:C52H44N2O2P2Purity:min. 94%Color and Shape:off-white pwdr.Molecular weight:790.881-NAPHTHALENECARBOXAMIDE, N,N'-(1S,2S)-1,2-CYCLOHEXANEDIYLBIS[2-(DIPHENYLPHOSPHINO)-
CAS:Formula:C52H44N2O2P2Purity:95%Color and Shape:SolidMolecular weight:790.8655N,N’-((1S,2S)-Cyclohexane-1,2-Diyl)Bis(2-(Diphenylphosphino)-1-Naphthamide)
CAS:N,N’-((1S,2S)-Cyclohexane-1,2-Diyl)Bis(2-(Diphenylphosphino)-1-Naphthamide)Purity:98%Molecular weight:790.88g/mol(1S,2S)-(-)-1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-naphthoyl)
CAS:(1S,2S)-(-)-1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-naphthoyl) is an alkoxyallene that is synthesized from the reaction of allene and ethylene oxide. It has been shown to inhibit abnormal cell growth in vitro. (1S,2S)-(-)-1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-naphthoyl) also inhibits cancer cell proliferation in vivo and shows a high degree of stereoselectivity and enantioselectivity. This compound can be used as an anticancer agent due to its ability to selectively kill cancer cells while leaving normal cells unharmed.Formula:C52H44N2O2P2Purity:Min. 94.5 Area-%Color and Shape:PowderMolecular weight:790.87 g/molN,N’-((1S,2S)-Cyclohexane-1,2-diyl)bis(2-(diphenylphosphino)-1-naphthamide)
CAS:Purity:97%Molecular weight:790.8839722




