CAS 2055-29-0
:3-(1-methyl-1-oxidopyrrolidin-2-yl)pyridine 1-oxide
Description:
3-(1-Methyl-1-oxidopyrrolidin-2-yl)pyridine 1-oxide, with the CAS number 2055-29-0, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a pyrrolidine moiety. This compound is classified as a heterocyclic organic compound, containing nitrogen atoms in both the pyridine and pyrrolidine rings. The presence of the 1-oxide functional group indicates that there is an oxygen atom bonded to the nitrogen in the pyrrolidine, which can influence its reactivity and solubility. Typically, such compounds exhibit properties like moderate polarity, which can affect their interactions in biological systems and their potential applications in medicinal chemistry. The compound may also exhibit basic properties due to the nitrogen atoms, making it a potential ligand in coordination chemistry. Its specific applications and biological activity would depend on further studies, but compounds of this nature are often explored for their roles in pharmaceuticals and as intermediates in organic synthesis.
Formula:C10H14N2O2
InChI:InChI=1/C10H14N2O2/c1-12(14)7-3-5-10(12)9-4-2-6-11(13)8-9/h2,4,6,8,10H,3,5,7H2,1H3
SMILES:CN1(=O)CCCC1c1cccn(=O)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1RS,2S)-Nicotine N,N'-Dioxide (3-[(1RS,2S)-1-Methyl-1-oxidopyrrolidin-2-yl]pyridine 1-Oxide)
CAS:Controlled ProductFormula:C10H14N2O2Color and Shape:NeatMolecular weight:194.23
