CAS 2055013-68-6

4,7,10,13,16,19,22,25-Octaoxaheptacosanoic acid, 27-(aminooxy)-, hydrochloride (1:1)

Description:

4,7,10,13,16,19,22,25-Octaoxaheptacosanoic acid, 27-(aminooxy)-, hydrochloride (1:1) is a complex organic compound characterized by its long carbon chain and multiple ether linkages, which contribute to its unique properties. The presence of eight ether groups in the structure enhances its solubility in polar solvents, making it useful in various biochemical applications. The aminooxy functional group allows for potential reactivity with carbonyl compounds, facilitating conjugation reactions in synthetic chemistry. As a hydrochloride salt, it is typically more stable and soluble in aqueous environments, which is advantageous for biological studies. This compound may exhibit surfactant properties due to its amphiphilic nature, enabling it to interact with both hydrophilic and hydrophobic substances. Its structural complexity suggests potential applications in drug delivery systems, biomaterials, or as a reagent in organic synthesis. However, specific biological activity, toxicity, and detailed applications would require further investigation and empirical studies to fully understand its behavior in various environments.

Formula: C₁₉H₃₉NO₁₁·ClH

InChI: InChI=1S/C19H39NO11.ClH/c20-31-18-17-30-16-15-29-14-13-28-12-11-27-10-9-26-8-7-25-6-5-24-4-3-23-2-1-19(21)22;/h1-18,20H2,(H,21,22);1H

InChI key: InChIKey=VZRILKOVZVJNDK-UHFFFAOYSA-N

SMILES: O(CCOCCOCCOCCOCCOCCON)CCOCCOCCC(O)=O.Cl

Synonyms:

• 4,7,10,13,16,19,22,25-Octaoxaheptacosanoic acid, 27-(aminooxy)-, hydrochloride (1:1)

Aminooxy-PEG8-acid

CAS: 2055013-68-6

Aminooxy-PEG8-acid is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₁₉H₄₀ClNO₁₁

Purity: 98%

Color and Shape: Solid

Molecular weight: 493.98

Ref: TM-T14278