CAS 2055023-35-1

13-[(1,1-Dimethylethoxy)carbonyl]-4,7,10,16,19,22-hexaoxa-13-azapentacosanedioic acid

Description:

The chemical substance known as 13-[(1,1-Dimethylethoxy)carbonyl]-4,7,10,16,19,22-hexaoxa-13-azapentacosanedioic acid is a complex organic compound characterized by its unique structure, which includes multiple functional groups and a long carbon chain. It features a hexaoxa framework, indicating the presence of six ether linkages, and an azapentacosanedioic acid backbone, which suggests the inclusion of nitrogen in its structure. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has protective or modifying functionalities, which can influence its reactivity and solubility. This compound is likely to exhibit properties typical of polyether and polyacid derivatives, such as potential biocompatibility and solubility in various solvents. Its intricate structure may also confer specific applications in fields such as materials science, drug delivery, or as a surfactant. However, detailed studies would be necessary to fully understand its physical and chemical properties, including melting point, boiling point, solubility, and reactivity under different conditions.

Formula: C₂₃H₄₃NO₁₂

InChI: InChI=1S/C23H43NO12/c1-23(2,3)36-22(29)24(6-10-32-14-18-34-16-12-30-8-4-20(25)26)7-11-33-15-19-35-17-13-31-9-5-21(27)28/h4-19H2,1-3H3,(H,25,26)(H,27,28)

InChI key: InChIKey=HVRLCVIGYIBUGD-UHFFFAOYSA-N

SMILES: N(CCOCCOCCOCCC(O)=O)(CCOCCOCCOCCC(O)=O)C(OC(C)(C)C)=O

Synonyms:

• 4,7,10,16,19,22-Hexaoxa-13-azapentacosanedioic acid, 13-[(1,1-dimethylethoxy)carbonyl]-
• 13-[(1,1-Dimethylethoxy)carbonyl]-4,7,10,16,19,22-hexaoxa-13-azapentacosanedioic acid

N-Boc-N-bis(PEG3-acid)

CAS: 2055023-35-1

N-Boc-N-bis(PEG3-acid) is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₂₃H₄₃NO₁₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 525.59

Ref: TM-T18393