CAS 2055023-77-1

3,6,9,15,18,21-Hexaoxa-12-thiatricosane, 1,23-diazido-

Description:

3,6,9,15,18,21-Hexaoxa-12-thiatricosane, 1,23-diazido- is a complex organic compound characterized by its unique structural features, including multiple ether (oxa) groups and a thiol (thio) group, which contribute to its chemical reactivity and solubility properties. The presence of azido groups (diazido) indicates potential for energetic applications, as azides are often associated with explosive properties. This compound likely exhibits a high degree of polarity due to the numerous oxygen atoms, which can influence its interactions with other substances, including solvents and biological molecules. The long carbon chain structure suggests that it may have surfactant-like properties, potentially allowing it to interact with lipid membranes or other hydrophobic environments. Additionally, the specific arrangement of functional groups can lead to interesting chemical behavior, such as the ability to undergo nucleophilic substitution reactions or participate in click chemistry. Overall, this compound's unique combination of functional groups and structural characteristics makes it a subject of interest in fields such as materials science, medicinal chemistry, and synthetic organic chemistry.

Formula: C₁₆H₃₂N₆O₆S

InChI: InChI=1S/C16H32N6O6S/c17-21-19-1-3-23-5-7-25-9-11-27-13-15-29-16-14-28-12-10-26-8-6-24-4-2-20-22-18/h1-16H2

InChI key: InChIKey=ABRFJJCUJNOGLS-UHFFFAOYSA-N

SMILES: S(CCOCCOCCOCCN=[N+]=[N-])CCOCCOCCOCCN=[N+]=[N-]

Synonyms:

• 3,6,9,15,18,21-Hexaoxa-12-thiatricosane, 1,23-diazido-
• 1,23-Diazido-3,6,9,15,18,21-hexaoxa-12-thiatricosane
• Azdo-PEG3-S-PEG3-Azide
• Azido-PEG3-S-PEG3-azide

Azido-PEG3-S-PEG3-azide

CAS: 2055023-77-1

Azido-PEG3-S-PEG3-azide is a polyethylene glycol (PEG)-derived linker specifically designed for the synthesis of proteolysis targeting chimeras (PROTACs)[1].

Formula: C₁₆H₃₂N₆O₆S

Purity: 98%

Color and Shape: Solid

Molecular weight: 436.53

Ref: TM-T17502