CAS 2055024-65-0

N-[3-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]-1-oxopropyl]-L-valyl-N5-(aminocarbonyl)-N-[4-(hydroxymethyl)phenyl]-L-ornithinamide

Description:

The chemical substance N-[3-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]-1-oxopropyl]-L-valyl-N5-(aminocarbonyl)-N-[4-(hydroxymethyl)phenyl]-L-ornithinamide, with CAS number 2055024-65-0, is a complex organic compound characterized by its multi-functional structure. It features an azido group, which is known for its reactivity and potential applications in click chemistry, as well as multiple ethoxy linkages that enhance solubility and stability. The presence of amino acids, such as L-valine and L-ornithine, suggests potential biological activity, possibly in peptide synthesis or as a pharmaceutical intermediate. The hydroxymethylphenyl moiety may contribute to its interaction with biological targets, enhancing its potential as a drug candidate. Overall, this compound's intricate structure indicates a versatile role in medicinal chemistry, particularly in the development of novel therapeutic agents or as a tool in biochemical research. Its unique functional groups and structural features warrant further investigation into its properties and applications in various fields.

Formula: C₂₇H₄₄N₈O₈

InChI: InChI=1S/C27H44N8O8/c1-19(2)24(34-23(37)9-12-41-14-16-43-17-15-42-13-11-31-35-29)26(39)33-22(4-3-10-30-27(28)40)25(38)32-21-7-5-20(18-36)6-8-21/h5-8,19,22,24,36H,3-4,9-18H2,1-2H3,(H,32,38)(H,33,39)(H,34,37)(H3,28,30,40)/t22-,24-/m0/s1

InChI key: InChIKey=UNBTYONTPDVRKD-UPVQGACJSA-N

SMILES: [C@H](C(NC1=CC=C(CO)C=C1)=O)(NC([C@@H](NC(CCOCCOCCOCCN=[N+]=[N-])=O)[C@@H](C)C)=O)CCCNC(N)=O

Synonyms:

• N-[3-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]-1-oxopropyl]-L-valyl-N5-(aminocarbonyl)-N-[4-(hydroxymethyl)phenyl]-L-ornithinamide
• L-Ornithinamide, N-[3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-1-oxopropyl]-L-valyl-N5-(aminocarbonyl)-N-[4-(hydroxymethyl)phenyl]-

Azido-PEG3-Val-Cit-PAB-OH

CAS: 2055024-65-0

Azido-PEG3-Val-Cit-PAB-OH is a cleavable three-unit polyethylene glycol antibody-drug conjugate (ADC) linker utilized in ADC synthesis [1].

Formula: C₂₇H₄₄N₈O₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 608.697

Ref: TM-T14435

Azido-PEG3-Val-Cit-PAB-OH

CAS: 2055024-65-0

Azido-PEG3-Val-Cit-PAB-OH is a peptide containing polyethylene glycol (PEG) as spacer to alter their pharmacokinetic properties and pharmodynamics.

Formula: C₂₇H₄₄N₈O₈

Purity: Min. 95%

Molecular weight: 608.7 g/mol

Ref: 3D-FHD02465