CAS 2055040-79-2

4-[(18-Carboxy-1-oxo-4,7,10,13,16-pentaoxaoctadec-1-yl)amino]-2,2,6,6-tetramethyl-1-piperidinyloxy

Description:

The chemical substance known as "4-[(18-Carboxy-1-oxo-4,7,10,13,16-pentaoxaoctadec-1-yl)amino]-2,2,6,6-tetramethyl-1-piperidinyloxy," with the CAS number 2055040-79-2, is a complex organic compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, substituted with a stable nitroxide radical, contributing to its potential antioxidant properties. The presence of a long-chain carboxylic acid moiety, along with multiple ether linkages, suggests that this compound may exhibit amphiphilic characteristics, allowing it to interact with both hydrophilic and hydrophobic environments. This structural diversity may impart unique solubility and reactivity profiles, making it of interest in various applications, including materials science and biochemistry. Additionally, the nitroxide functionality can play a role in redox chemistry, potentially enabling its use in radical scavenging or as a spin label in electron paramagnetic resonance (EPR) studies. Overall, this compound represents a fascinating intersection of organic chemistry and materials science.

Formula: C₂₃H₄₃N₂O₉

InChI: InChI=1S/C23H43N2O9/c1-22(2)17-19(18-23(3,4)25(22)29)24-20(26)5-7-30-9-11-32-13-15-34-16-14-33-12-10-31-8-6-21(27)28/h19H,5-18H2,1-4H3,(H,24,26)(H,27,28)

InChI key: InChIKey=UGFYUXWUXOOSOD-UHFFFAOYSA-N

SMILES: N(C(CCOCCOCCOCCOCCOCCC(O)=O)=O)C1CC(C)(C)N([O])C(C)(C)C1

Synonyms:

• 4-[(18-Carboxy-1-oxo-4,7,10,13,16-pentaoxaoctadec-1-yl)amino]-2,2,6,6-tetramethyl-1-piperidinyloxy
• 1-Piperidinyloxy, 4-[(18-carboxy-1-oxo-4,7,10,13,16-pentaoxaoctadec-1-yl)amino]-2,2,6,6-tetramethyl-

Acid-PEG5-TEMPO

CAS: 2055040-79-2

Acid-PEG5-TEMPO is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₂₃H₄₃N₂O₉

Purity: 98%

Color and Shape: Solid

Molecular weight: 491.602

Ref: TM-T14110