CAS 2055040-96-3

1,1-Dimethylethyl 4,7,10,16,19,22-hexaoxa-13-thiatricosanoate

Description:

1,1-Dimethylethyl 4,7,10,16,19,22-hexaoxa-13-thiatricosanoate is a complex organic compound characterized by its unique structure, which includes multiple ether linkages and a thioether functional group. The presence of six ether (–O–) groups contributes to its solubility in polar solvents, while the thioether (–S–) group may impart distinct chemical reactivity and stability. This compound is likely to exhibit properties typical of polyether compounds, such as flexibility and low volatility, making it suitable for various applications in materials science and pharmaceuticals. Its molecular structure suggests potential uses in drug delivery systems or as a surfactant due to the amphiphilic nature imparted by the hydrophilic ether segments and the hydrophobic hydrocarbon chain. Additionally, the branched alkyl group (1,1-dimethylethyl) may enhance its steric properties, influencing its interactions with biological systems or other chemical entities. Overall, this compound's unique combination of functional groups and structural features positions it as a versatile candidate for further research and application in diverse fields.

Formula: C₂₀H₄₀O₈S

InChI: InChI=1S/C20H40O8S/c1-20(2,3)28-19(21)5-6-23-9-10-25-12-14-27-16-18-29-17-15-26-13-11-24-8-7-22-4/h5-18H2,1-4H3

InChI key: InChIKey=HPUREYBEJCEQQQ-UHFFFAOYSA-N

SMILES: O(CCOCCOCCSCCOCCOCCOC)CCC(OC(C)(C)C)=O

Synonyms:

• 1,1-Dimethylethyl 4,7,10,16,19,22-hexaoxa-13-thiatricosanoate
• 4,7,10,16,19,22-Hexaoxa-13-thiatricosanoic acid, 1,1-dimethylethyl ester
• m-PEG3-S-PEG3-t-butyl ester
• m-PEG3-S-PEG3-Boc

m-PEG3-S-PEG3-Boc

CAS: 2055040-96-3

m-PEG3-S-PEG3-Boc is a polyethylene glycol (PEG) and alkyl/ether-based linker utilized in the synthesis of PROteolysis TArgeting Chimeras (PROTACs)[1].

Formula: C₂₀H₄₀O₈S

Purity: 98%

Color and Shape: Solid

Molecular weight: 440.59

Ref: TM-T18182