CAS 2055041-00-2

4,7,10,16,19,22-Hexaoxa-13-thiatricosanoic acid, 1,1-dimethylethyl ester, 13,13-dioxide

Description:

4,7,10,16,19,22-Hexaoxa-13-thiatricosanoic acid, 1,1-dimethylethyl ester, 13,13-dioxide, identified by CAS number 2055041-00-2, is a complex organic compound characterized by its unique structure that includes multiple ether and thioether linkages. This compound features a long carbon chain with six ether (–O–) groups and a thioether (–S–) group, contributing to its solubility and reactivity. The presence of the dimethylethyl ester functional group indicates that it may exhibit properties typical of esters, such as lower volatility and potential for hydrolysis. The 13,13-dioxide designation suggests that there are two double-bonded oxygen atoms in the structure, which can influence its chemical behavior, stability, and interactions with other substances. This compound may be of interest in various fields, including materials science and pharmaceuticals, due to its potential applications in drug delivery systems or as a surfactant. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₂₀H₄₀O₁₀S

InChI: InChI=1S/C20H40O10S/c1-20(2,3)30-19(21)5-6-25-9-10-27-12-14-29-16-18-31(22,23)17-15-28-13-11-26-8-7-24-4/h5-18H2,1-4H3

InChI key: InChIKey=NIESCEHPGVJPBT-UHFFFAOYSA-N

SMILES: C(S(CCOCCOCCOC)(=O)=O)COCCOCCOCCC(OC(C)(C)C)=O

Synonyms:

• 4,7,10,16,19,22-Hexaoxa-13-thiatricosanoic acid, 1,1-dimethylethyl ester, 13,13-dioxide

m-PEG3-Sulfone-PEG3-Boc

CAS: 2055041-00-2

m-PEG3-Sulfone-PEG3-Boc is a polyethylene glycol (PEG)-derived proteolysis-targeting chimera (PROTAC) linker employed for the synthesis of PROTACs[1].

Formula: C₂₀H₄₀O₁₀S

Purity: 98%

Color and Shape: Solid

Molecular weight: 472.59

Ref: TM-T18187