
CAS 2055041-03-5
:4-[[[(2-Carboxyethyl)thio]thioxomethyl]thio]-4-cyanopentanoic acid
Description:
4-[[[(2-Carboxyethyl)thio]thioxomethyl]thio]-4-cyanopentanoic acid is a chemical compound characterized by its complex structure, which includes multiple functional groups such as carboxylic acid, thioether, and cyanide. This compound features a pentanoic acid backbone, which is substituted at the 4-position with a thioether group that contains a thioxomethyl moiety and a carboxyethyl side chain. The presence of the cyanide group indicates potential reactivity, particularly in nucleophilic addition reactions. The thioether and thioxomethyl groups contribute to the compound's unique chemical properties, including potential applications in organic synthesis or as intermediates in pharmaceutical development. Its solubility and stability can vary depending on the pH and solvent used, which is typical for compounds with acidic and basic functional groups. Overall, this compound's intricate structure suggests it may have specialized uses in research or industry, particularly in fields related to medicinal chemistry or materials science.
Formula:C10H13NO4S3
InChI:InChI=1S/C10H13NO4S3/c1-10(6-11,4-2-7(12)13)18-9(16)17-5-3-8(14)15/h2-5H2,1H3,(H,12,13)(H,14,15)
InChI key:InChIKey=CTLAWKZAJCYIFX-UHFFFAOYSA-N
SMILES:C(SC(SCCC(O)=O)=S)(CCC(O)=O)(C#N)C
Synonyms:- 4-[(2-Carboxyethylsulfanylthiocarbonyl)sulfanyl]-4-cyanopentanic acid
- 4-((((2-Carboxyethyl)thio)carbonothioyl)thio)-4-cyanopentanoic acid
- 4-[[[(2-Carboxyethyl)thio]thioxomethyl]thio]-4-cyanopentanoic acid
- Pentanoic acid, 4-[[[(2-carboxyethyl)thio]thioxomethyl]thio]-4-cyano-
- BM 1433
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-((((2-Carboxyethyl)Thio)Carbonothioyl)Thio)-4-Cyanopentanoic Acid
CAS:Formula:C10H13NO4S3Purity:95%Color and Shape:SolidMolecular weight:307.40954-((((2-Carboxyethyl)thio)carbonothioyl)thio)-4-cyanopentanoic acid
CAS:4-((((2-Carboxyethyl)thio)carbonothioyl)thio)-4-cyanopentanoic acidPurity:95%Molecular weight:307.41g/mol4-((((2-Carboxyethyl)thio)carbonothioyl)thio)-4-cyanopentanoic acid
CAS:4-(((2-Carboxyethyl)thio)carbonothioyl)thiopentanoic acid is a monomer that is used in the polymerization process. It has been shown to be an electron acceptor and undergoes a reaction rate that is enhanced by irradiation with electrons or UV light. The reaction is selective for the carbon atom at the thiopentanoic acid end of the molecule, which results in fragmentation of the molecule. This leads to a yellow color when irradiated with red light. When irradiated with blue light, the molecule will react more slowly and produce a red color.
Formula:C10H13NO4S3Purity:Min. 95%Color and Shape:PowderMolecular weight:307.4 g/mol4-((((2-Carboxyethyl)thio)carbonothioyl)thio)-4-cyanopentanoic acid
CAS:Purity:95%Molecular weight:307.3999939



