CAS 2055041-16-0

4,7,10,13,16,19,22,25-Octaoxa-28-azatriacontanoic acid, 30-bromo-29-oxo-, 1,1-dimethylethyl ester

Description:

4,7,10,13,16,19,22,25-Octaoxa-28-azatriacontanoic acid, 30-bromo-29-oxo-, 1,1-dimethylethyl ester is a complex organic compound characterized by its long carbon chain and multiple functional groups. The presence of eight ether linkages (indicated by "octaoxa") suggests significant solubility in polar solvents, while the azatriacontanoic acid structure implies potential for hydrogen bonding and reactivity due to the carboxylic acid group. The bromine atom introduces halogen reactivity, which can be leveraged in various chemical reactions, including substitution and coupling reactions. The dimethylethyl ester moiety indicates that the compound is likely to be lipophilic, enhancing its potential applications in drug delivery or as a surfactant. Its structural complexity may also confer unique properties such as increased stability or specific interactions with biological systems. Overall, this compound's unique combination of functional groups and structural features positions it as a potentially valuable substance in fields such as medicinal chemistry, materials science, and biochemistry.

Formula: C₂₅H₄₈BrNO₁₁

InChI: InChI=1S/C25H48BrNO11/c1-25(2,3)38-24(29)4-6-30-8-10-32-12-14-34-16-18-36-20-21-37-19-17-35-15-13-33-11-9-31-7-5-27-23(28)22-26/h4-22H2,1-3H3,(H,27,28)

InChI key: InChIKey=BPWCFBGOCYWQSQ-UHFFFAOYSA-N

SMILES: C(COCCOCCOCCOCCOCCOCCOCCNC(CBr)=O)OCCC(OC(C)(C)C)=O

Synonyms:

• 1,1-Dimethylethyl 30-bromo-29-oxo-4,7,10,13,16,19,22,25-octaoxa-28-azatriacontanoate
• 4,7,10,13,16,19,22,25-Octaoxa-28-azatriacontanoic acid, 30-bromo-29-oxo-, 1,1-dimethylethyl ester
• Bromoacetamido-PEG8-Boc
• Bromoacetamido-PEG8-t-butyl ester

Bromoacetamido-PEG8-Boc

CAS: 2055041-16-0

Bromoacetamido-PEG8-Boc is a PEG-based linker compound utilized for synthesizing PROTACs, which are molecules designed for targeted protein degradation[1].

Formula: C₂₅H₄₈BrNO₁₁

Purity: 98%

Color and Shape: Solid

Molecular weight: 618.55

Ref: TM-T14828