CymitQuimica logo

CAS 2055041-40-0

:

N-[3-(2-Azidoethoxy)-1-oxopropyl]-L-valyl-N5-(aminocarbonyl)-N-[4-(hydroxymethyl)phenyl]-L-ornithinamide

Description:
N-[3-(2-Azidoethoxy)-1-oxopropyl]-L-valyl-N5-(aminocarbonyl)-N-[4-(hydroxymethyl)phenyl]-L-ornithinamide is a complex organic compound characterized by its unique structural features, including an azido group, which is known for its reactivity and utility in click chemistry. The presence of amino acids such as L-valine and L-ornithine suggests potential biological activity, possibly related to peptide synthesis or drug development. The compound also contains functional groups such as an amide and a hydroxymethyl phenyl moiety, which may enhance solubility and interaction with biological targets. Its azido group can facilitate further chemical modifications, making it a versatile building block in medicinal chemistry. The compound's molecular structure indicates potential applications in areas such as bioconjugation, targeted drug delivery, or as a probe in biochemical research. However, specific safety and handling information should be consulted, as compounds with azido groups can pose risks due to their explosive nature under certain conditions.
Formula:C23H36N8O6
InChI:InChI=1S/C23H36N8O6/c1-15(2)20(30-19(33)9-12-37-13-11-27-31-25)22(35)29-18(4-3-10-26-23(24)36)21(34)28-17-7-5-16(14-32)6-8-17/h5-8,15,18,20,32H,3-4,9-14H2,1-2H3,(H,28,34)(H,29,35)(H,30,33)(H3,24,26,36)/t18-,20-/m0/s1
InChI key:InChIKey=BDMOXMNQSIHXBI-ICSRJNTNSA-N
SMILES:[C@H](C(NC1=CC=C(CO)C=C1)=O)(NC([C@@H](NC(CCOCCN=[N+]=[N-])=O)[C@H](C)C)=O)CCCNC(N)=O
Synonyms:
  • N-[3-(2-Azidoethoxy)-1-oxopropyl]-L-valyl-N5-(aminocarbonyl)-N-[4-(hydroxymethyl)phenyl]-L-ornithinamide
  • L-Ornithinamide, N-[3-(2-azidoethoxy)-1-oxopropyl]-L-valyl-N5-(aminocarbonyl)-N-[4-(hydroxymethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.