CAS 2055107-43-0: 2,4-Dichloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine

Description:2,4-Dichloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine is a synthetic organic compound characterized by its unique thieno[2,3-d]pyrimidine core structure, which incorporates both chlorine and trifluoroethyl substituents. The presence of two chlorine atoms at the 2 and 4 positions enhances its reactivity and potential biological activity, while the trifluoroethyl group at the 6 position contributes to its lipophilicity and may influence its interaction with biological targets. This compound is likely to exhibit properties typical of heterocyclic compounds, including potential applications in pharmaceuticals or agrochemicals due to its structural features. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions or electrophilic additions. Additionally, the trifluoroethyl group can impart unique electronic properties, potentially affecting the compound's stability and solubility in different solvents. As with many halogenated compounds, considerations regarding environmental impact and toxicity are essential for its handling and application.

Formula:C₈H₃Cl₂F₃N₂S

InChI:InChI=1S/C8H3Cl2F3N2S/c9-5-4-1-3(2-8(11,12)13)16-6(4)15-7(10)14-5/h1H,2H2

InChI key:InChIKey=FEYZVLSTIGXTIY-UHFFFAOYSA-N

SMILES:FC(F)(F)CC=1SC=2N=C(Cl)N=C(Cl)C2C1

Synonyms:
Thieno[2,3-d]pyrimidine, 2,4-dichloro-6-(2,2,2-trifluoroethyl)-
2,4-Dichloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2,4-dichloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine REF: IN-DA01DW5MCAS: 2055107-43-0	97%	To inquire	Mon 14 Apr 25
2,4-Dichloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine REF: 10-F608697CAS: 2055107-43-0	95%	To inquire	Thu 24 Apr 25
2,4-Dichloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine REF: 3D-FHD10743CAS: 2055107-43-0	Min. 95%	185.00 €~2,390.00 €	Tue 27 May 25