
CAS 2055119-00-9
:1,3-Dimethyl 2-[3-cyano-5-(trifluoromethyl)-2-pyridinyl]propanedioate
Description:
1,3-Dimethyl 2-[3-cyano-5-(trifluoromethyl)-2-pyridinyl]propanedioate, with the CAS number 2055119-00-9, is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a cyano group and a trifluoromethyl group. This compound features a propanedioate backbone, which is further substituted with two methyl groups at the 1 and 3 positions. The presence of the cyano group contributes to its potential reactivity, while the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. The compound is likely to exhibit polar characteristics due to the cyano and ester functionalities, making it soluble in polar solvents. Its unique structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of compounds with specific biological activities. As with many organic compounds, safety and handling precautions should be observed, as the trifluoromethyl group can impart toxicity and environmental concerns.
Formula:C12H9F3N2O4
InChI:InChI=1S/C12H9F3N2O4/c1-20-10(18)8(11(19)21-2)9-6(4-16)3-7(5-17-9)12(13,14)15/h3,5,8H,1-2H3
InChI key:InChIKey=ZJGFKRBBQGSZLY-UHFFFAOYSA-N
SMILES:C(C(OC)=O)(C(OC)=O)C1=C(C#N)C=C(C(F)(F)F)C=N1
Synonyms:- Propanedioic acid, 2-[3-cyano-5-(trifluoromethyl)-2-pyridinyl]-, 1,3-dimethyl ester
- 1,3-Dimethyl 2-[3-cyano-5-(trifluoromethyl)-2-pyridinyl]propanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.