CAS 205528-30-9
:Fmoc-3-(4-pyridyl)-D-alanine
Description:
Fmoc-3-(4-pyridyl)-D-alanine is a chemical compound that belongs to the class of amino acids, specifically a derivative of D-alanine. It features a 9-fluorenylmethoxycarbonyl (Fmoc) protecting group, which is commonly used in peptide synthesis to protect the amino group during the coupling reactions. The presence of a 4-pyridyl group introduces a heterocyclic aromatic ring, which can enhance the compound's solubility and reactivity in various chemical environments. This compound is typically utilized in the field of organic chemistry and biochemistry, particularly in the synthesis of peptides and other bioactive molecules. Its structure allows for potential interactions in biological systems, making it of interest for drug design and development. The compound is generally stable under standard laboratory conditions but should be handled with care, following appropriate safety protocols. As with many chemical substances, it is important to consult safety data sheets and relevant literature for specific handling and storage recommendations.
Formula:C23H20N2O4
InChI:InChI=1/C23H20N2O4/c26-22(27)21(13-15-9-11-24-12-10-15)25-23(28)29-14-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-12,20-21H,13-14H2,(H,25,28)(H,26,27)/t21-/m1/s1
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=N[C@H](Cc1ccncc1)C(=O)O)O
Synonyms:- Fmoc-D-4-Pyridylalanine
- Fmoc-D-3-(4-Pyridyl)-alanine
- Fmoc-D-4-Pal-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Fmoc-3-(4-pyridyl)-D-alanine, 95%
CAS:<p>N-Fmoc-3-(4-pyridyl)-D-alanine is an Fmoc protected alanine derivative that is potentially useful for proteomics studies and solid phase peptide synthesis techniques. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label</p>Formula:C23H20N2O4Purity:95%Molecular weight:388.42Fmoc-D-(4-pyridyl)alanine
CAS:Formula:C23H20N2O4Purity:98%Color and Shape:SolidMolecular weight:388.41593-Pyridin-4-yl-D-alanine, N-FMOC protected
CAS:3-Pyridin-4-yl-D-alanine, N-FMOC protectedPurity:98%Molecular weight:388.4159g/mol(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(pyridin-4-yl)propanoic acid
CAS:Formula:C23H20N2O4Purity:98%Color and Shape:SolidMolecular weight:388.423




