CAS 205535-92-8

benzyl {2-[2-(2-hydroxyethoxy)ethoxy]ethyl}carbamate

Description:

Benzyl {2-[2-(2-hydroxyethoxy)ethoxy]ethyl}carbamate, identified by its CAS number 205535-92-8, is a chemical compound characterized by its carbamate functional group, which is linked to a benzyl moiety and a polyether chain. This structure suggests that it may exhibit properties typical of both carbamates and ether compounds, including potential solubility in organic solvents and moderate polarity. The presence of the hydroxyethoxy groups indicates that the compound may have hydrophilic characteristics, which could enhance its solubility in aqueous environments. Additionally, the benzyl group may contribute to the compound's stability and potential for interaction with biological systems. Such compounds are often studied for their applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which the compound is used. Safety data and handling precautions should be consulted for practical applications.

Formula: C₁₄H₂₁NO₅

InChI: InChI=1/C14H21NO5/c16-7-9-19-11-10-18-8-6-15-14(17)20-12-13-4-2-1-3-5-13/h1-5,16H,6-12H2,(H,15,17)

Carbamic acid, N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-, phenylmethyl ester

CAS: 205535-92-8

Formula: C₁₄H₂₁NO₅

Purity: 98%

Color and Shape: Liquid

Molecular weight: 283.3202

Ref: IN-DA002A5I

CbzNH-PEG3-OH

CAS: 205535-92-8

CbzNH-PEG3-OH

Purity: 98%

Ref: 54-OR1042398

Carbamic acid, N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-, phenylmethyl ester

CAS: 205535-92-8

Purity: 98%

Color and Shape: Liquid

Molecular weight: 283.3240051

Ref: 10-F865813

Cbznh-PEG3-OH

CAS: 205535-92-8

Cbznh-PEG3-OH is a pegylation product that belongs to the family of PEG products. It is a derivative of Cbz-NH-PEG5-OH and Cbz-N-PEG5-OH, which are carboxybenzyl amido PEG compounds. Pegylation is the process of attaching polyethylene glycol (PEG) chains to molecules, such as proteins or drugs, to enhance their stability, solubility, and bioavailability. Cbznh-PEG3-OH can be used in various applications, including drug delivery systems, diagnostics, and biotechnology. Its unique chemical structure allows for precise control over the size and properties of the PEG chains, making it a versatile tool in the field of biomedical research.

Formula: C₁₄H₂₁NO₅

Purity: Min. 95%

Molecular weight: 283.32 g/mol

Ref: 3D-FIA53592