CAS 2055405-77-9

5-Azaspiro[2.5]octane, 7-methyl-, hydrochloride (1:1)

Description:

5-Azaspiro[2.5]octane, 7-methyl-, hydrochloride (1:1) is a chemical compound characterized by its spirocyclic structure, which includes a nitrogen atom in the spiro framework. This compound features a bicyclic system that contributes to its unique three-dimensional conformation, potentially influencing its biological activity and interactions. The presence of the hydrochloride indicates that it is a salt form, which often enhances solubility in water and may affect its pharmacokinetic properties. The methyl group at the 7-position can influence the compound's steric and electronic properties, potentially impacting its reactivity and biological function. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. This compound may be of interest in medicinal chemistry and pharmacology, particularly in the development of new therapeutic agents. However, specific biological activities, toxicity, and applications would require further investigation and research to fully understand its potential uses and effects.

Formula: C₈H₁₅N·ClH

InChI: InChI=1S/C8H15N.ClH/c1-7-4-8(2-3-8)6-9-5-7;/h7,9H,2-6H2,1H3;1H

InChI key: InChIKey=MZNPPZONWYFRIY-UHFFFAOYSA-N

SMILES: CC1CC2(CC2)CNC1.Cl

Synonyms:

• 5-Azaspiro[2.5]octane, 7-methyl-, hydrochloride (1:1)

7-methyl-5-azaspiro[2.5]octane hydrochloride

CAS: 2055405-77-9

Formula: C₈H₁₆ClN

Purity: 95.0%

Molecular weight: 161.67

Ref: 10-F054083