CAS 2055405-78-0

4-Piperidinamine, 1-(3-pyridazinyl)-, hydrochloride (1:1)

Description:

4-Piperidinamine, 1-(3-pyridazinyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and pyridazine moieties, which contribute to its potential biological activity. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The molecular structure features a piperidine ring, a six-membered saturated nitrogen-containing ring, and a pyridazine ring, which is a six-membered aromatic ring with two adjacent nitrogen atoms. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. As with many amines, it may exhibit basic properties, allowing it to form salts with acids. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological properties and potential therapeutic uses.

Formula: C₉H₁₄N₄·ClH

InChI: InChI=1S/C9H14N4.ClH/c10-8-3-6-13(7-4-8)9-2-1-5-11-12-9;/h1-2,5,8H,3-4,6-7,10H2;1H

InChI key: InChIKey=UOJCLDVUPPYRPU-UHFFFAOYSA-N

SMILES: NC1CCN(CC1)C2=CC=CN=N2.Cl

Synonyms:

• 4-Piperidinamine, 1-(3-pyridazinyl)-, hydrochloride (1:1)

1-(3-pyridazinyl)-4-piperidinamine hydrochloride

CAS: 2055405-78-0

Formula: C₉H₁₅ClN₄

Purity: 95.0%

Molecular weight: 214.7

Ref: 10-F054054