CAS 20555-91-3
:1,2-Dichloro-4-iodobenzene
Description:
1,2-Dichloro-4-iodobenzene is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with two chlorine atoms and one iodine atom. The specific positions of these substituents are crucial, as they influence the compound's reactivity and physical properties. This compound typically appears as a colorless to pale yellow solid and is known for its moderate solubility in organic solvents, while being less soluble in water. It has a relatively high melting point and boiling point compared to many other organic compounds, reflecting the presence of halogen substituents, which can enhance intermolecular interactions. 1,2-Dichloro-4-iodobenzene is utilized in various chemical syntheses and research applications, particularly in the fields of organic chemistry and materials science. Its halogenated nature makes it a potential candidate for further reactions, such as nucleophilic substitutions or coupling reactions. However, handling this compound requires caution due to the potential toxicity associated with halogenated organic compounds.
Formula:C6H3Cl2I
InChI:InChI=1S/C6H3Cl2I/c7-5-2-1-4(9)3-6(5)8/h1-3H
InChI key:InChIKey=NADPFZNWCQIJJW-UHFFFAOYSA-N
SMILES:ClC1=C(Cl)C=CC(I)=C1
Synonyms:- 1-Iodo-3,4-dichlorobenzene
- 3,4-Dichloro-1-iodobenzene
- 3,4-Dichloroiodobenzene
- 3,4-Dichlorophenyl iodide
- 4-Iodo-1,2-dichlorobenzene
- Benzene, 1,2-dichloro-4-iodo-
- 1,2-Dichloro-4-iodobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,2-Dichloro-4-iodobenzene
CAS:Formula:C6H3Cl2IPurity:>98.0%(GC)Color and Shape:White or Colorless to Yellow powder to lump to clear liquidMolecular weight:272.891,2-Dichloro-4-iodobenzene, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H3Cl2IPurity:98%Color and Shape:Fused solid, Pale yellow to pale browmMolecular weight:272.89Benzene, 1,2-dichloro-4-iodo-
CAS:Formula:C6H3Cl2IPurity:97%Color and Shape:SolidMolecular weight:272.89851,2-Dichloro-4-iodobenzene, min. 98%
CAS:Formula:C6H3Cl2IPurity:min. 98%Color and Shape:White to off-white solid/ colorless to pale yellow-brown liquid dependent on the temperature. Solid at 20°CMolecular weight:272.891,2-Dichloro-4-iodobenzene
CAS:Formula:C6H3Cl2IPurity:97%Color and Shape:Low Melting SolidMolecular weight:272.893,4-Dichloroiodobenzene
CAS:3,4-DichloroiodobenzeneFormula:C6H3Cl2IPurity:99%Color and Shape: faint beige fused solidMolecular weight:272.90g/mol






