CymitQuimica logo

CAS 2055839-95-5

:

Cyclobutanemethanamine, 2,2-difluoro-, hydrochloride (1:1)

Description:
Cyclobutanemethanamine, 2,2-difluoro-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and an amine functional group. The presence of two fluorine atoms at the 2,2-positions of the cyclobutane contributes to its distinct chemical properties, potentially influencing its reactivity and polarity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals. The compound may exhibit biological activity due to the amine group, which can participate in hydrogen bonding and interact with biological targets. Its molecular weight, melting point, and specific reactivity would depend on the precise arrangement of atoms and the presence of functional groups. Safety data sheets would provide essential information regarding handling, storage, and potential hazards associated with this compound. Overall, cyclobutanemethanamine, 2,2-difluoro-, hydrochloride is of interest in both synthetic chemistry and medicinal chemistry contexts.
Formula:C5H9F2N.ClH
InChI:InChI=1S/C5H9F2N.ClH/c6-5(7)2-1-4(5)3-8;/h4H,1-3,8H2;1H
InChI key:InChIKey=YBIVAKBKIJCQGS-UHFFFAOYSA-N
SMILES:C(N)C1C(F)(F)CC1.Cl
Found 4 products.