CAS 2055840-97-4

3-Furancarboxylic acid, tetrahydro-4-[[(1R)-1-phenylethyl]amino]-, methyl ester, (3S,4S)-rel-

Description:

3-Furancarboxylic acid, tetrahydro-4-[[(1R)-1-phenylethyl]amino]-, methyl ester, (3S,4S)-rel- is a chemical compound characterized by its unique structural features, including a furan ring and a tetrahydrofuran moiety. This compound contains a carboxylic acid functional group and an ester linkage, which contribute to its reactivity and solubility properties. The presence of the phenylethylamine moiety suggests potential biological activity, as amines often play significant roles in pharmacology. The stereochemistry indicated by the (3S,4S)- designation implies specific spatial arrangements of atoms, which can influence the compound's interactions and efficacy in biological systems. Additionally, the methyl ester group enhances lipophilicity, potentially affecting its absorption and distribution in biological contexts. Overall, this compound may be of interest in medicinal chemistry and drug development due to its structural complexity and potential therapeutic applications.

Formula: C₁₄H₁₉NO₃

InChI: InChI=1/C14H19NO3/c1-10(11-6-4-3-5-7-11)15-13-9-18-8-12(13)14(16)17-2/h3-7,10,12-13,15H,8-9H2,1-2H3/t10-,12-,13-/s2

InChI key: InChIKey=VYWULYQHYAJIJY-BGNYBJMONA-N

SMILES: C(OC)(=O)[C@H]1[C@H](N[C@H](C)C2=CC=CC=C2)COC1

Synonyms:

• 3-Furancarboxylic acid, tetrahydro-4-[[(1R)-1-phenylethyl]amino]-, methyl ester, (3S,4S)-rel-
• rel-Methyl (3S,4S)-tetrahydro-4-[[(1R)-1-phenylethyl]amino]-3-furancarboxylate

Rel-methyl (3s,4s)-4-([(1r)-1-phenylethyl]amino)oxolane-3-carboxylate

CAS: 2055840-97-4

Formula: C₁₄H₁₉NO₃

Purity: 97%

Molecular weight: 249.3056

Ref: IN-DA002A6X