CAS 20567-38-8
:4,5-Dimethoxy-2-nitrocinnamic acid
Description:
4,5-Dimethoxy-2-nitrocinnamic acid is an organic compound characterized by its unique structure, which includes a cinnamic acid backbone modified by two methoxy groups and a nitro group. This compound typically appears as a yellow to orange crystalline solid. It is known for its potential applications in organic synthesis and as a building block in the development of various pharmaceuticals and agrochemicals. The presence of the nitro group contributes to its reactivity, making it a useful intermediate in chemical reactions, while the methoxy groups can influence its solubility and electronic properties. The compound is generally stable under standard conditions but may require careful handling due to the presence of the nitro group, which can be sensitive to reduction reactions. Additionally, its solubility in organic solvents and limited solubility in water can affect its application in different chemical processes. As with many organic compounds, safety precautions should be taken when handling this substance, including the use of appropriate personal protective equipment.
Formula:C11H10NO6
InChI:InChI=1/C11H11NO6/c1-17-9-5-7(3-4-11(13)14)8(12(15)16)6-10(9)18-2/h3-6H,1-2H3,(H,13,14)/p-1/b4-3+
Synonyms:- (2E)-3-(4,5-Dimethoxy-2-nitrophenyl)acrylic acid
- (2E)-3-(4,5-Dimethoxy-2-nitrophenyl)acryls?ure
- 2-Propenoic acid, 3-(4,5-dimethoxy-2-nitrophenyl)-, (2E)-
- 3-(4,5-Dimethoxy-2-Nitrophenyl)Acrylic Acid
- Acide (2E)-3-(4,5-diméthoxy-2-nitrophényl)acrylique
- (2E)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoic acid
- (2E)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Propenoic acid, 3-(4,5-dimethoxy-2-nitrophenyl)-
CAS:Formula:C11H11NO6Purity:98%Color and Shape:SolidMolecular weight:253.20814,5-Dimethoxy-2-nitrocinnamic acid
CAS:4,5-Dimethoxy-2-nitrocinnamic acidPurity:98%Molecular weight:253.21g/mol4,5-Dimethoxy-2-nitrocinnamic acid
CAS:4,5-Dimethoxy-2-nitrocinnamic acid is a versatile building block that can be used as a reagent or speciality chemical. It is useful for the synthesis of complex compounds, and can be used as a reaction component or scaffold in organic chemistry. 4,5-Dimethoxy-2-nitrocinnamic acid is a high quality intermediate with CAS No. 20567-38-8.
Formula:C11H11NO6Purity:Min. 95%Molecular weight:253.21 g/mol3,4-Dimethoxy-6-nitrocinnamic acid
CAS:Formula:C11H11NO6Purity:98%Color and Shape:SolidMolecular weight:253.21



