CAS 20567-67-3

6-methyl-3,4-dihydro-2H-Pyrido[3,2-b]-1,4-oxazine

Description:

6-Methyl-3,4-dihydro-2H-pyrido[3,2-b]-1,4-oxazine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyridine and an oxazine ring. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents, reflecting its non-polar characteristics. The presence of the methyl group contributes to its hydrophobic nature, influencing its reactivity and interaction with other chemical species. It may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. The compound's structure allows for potential hydrogen bonding and dipole interactions, which can affect its physical properties such as melting and boiling points. Additionally, its stability and reactivity can be influenced by the presence of functional groups and the overall electronic environment within the molecule. As with many heterocycles, it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it a versatile compound in synthetic organic chemistry.

Formula: C₈H₁₀N₂O

InChI: InChI=1S/C8H10N2O/c1-6-2-3-7-8(10-6)9-4-5-11-7/h2-3H,4-5H2,1H3,(H,9,10)

SMILES: Cc1ccc2c(NCCO2)n1

Synonyms:

• 2H-Pyrido[3,2-b]-1,4-oxazine, 3,4-dihydro-6-methyl-

6-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine

CAS: 20567-67-3

Formula: C₈H₁₀N₂O

Molecular weight: 150.1778

Ref: IN-DA002AA8

6-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine

CAS: 20567-67-3

Versatile small molecule scaffold

Formula: C₈H₁₀N₂O

Purity: Min. 95%

Molecular weight: 150.18 g/mol

Ref: 3D-VAA56767