CAS 2057-84-3: n-Valeraldehyde 2,4-dinitrophenylhydrazone
Description:n-Valeraldehyde 2,4-dinitrophenylhydrazone is a chemical compound formed from the reaction of n-valeraldehyde with 2,4-dinitrophenylhydrazine, a reagent commonly used in organic chemistry for the identification of aldehydes and ketones. This compound typically appears as a yellow to orange crystalline solid, indicative of the presence of the dinitrophenylhydrazone moiety, which is known for its strong chromophoric properties. It is characterized by its melting point, solubility in organic solvents, and stability under standard laboratory conditions. The compound is often utilized in analytical chemistry for the qualitative and quantitative analysis of aldehydes, as it forms stable derivatives that can be easily isolated and characterized. Additionally, n-Valeraldehyde 2,4-dinitrophenylhydrazone may exhibit specific reactivity patterns, such as undergoing further reactions under acidic or basic conditions, which can be leveraged in synthetic applications. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C11H14N4O4
InChI:InChI=1S/C11H14N4O4/c1-2-3-4-7-12-13-10-6-5-9(14(16)17)8-11(10)15(18)19/h5-8,13H,2-4H2,1H3
InChI key:InChIKey=XGVOZGLOQUHZBZ-UHFFFAOYSA-N
SMILES:O=N(=O)C1=CC=C(NN=CCCCC)C(=C1)N(=O)=O
- Synonyms:
- NSC 403613
- Pentanal, 2-(2,4-dinitrophenyl)hydrazone
- Valeraldehyde, (2,4-dinitrophenyl)hydrazone
- Pentanal, (2,4-dinitrophenyl)hydrazone
- n-Valeraldehyde 2,4-dinitrophenylhydrazone
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | HJ 1154-2020 Aldehyde-DNPHs and Ketone-DNPHs Mixture 347 100 µg/mL in Acetonitrile REF: 04-A50000350ALCAS: | - - - | To inquire | Tue 29 Apr 25 |
![]() | Valeraldehyde-2,4-DNPH REF: 3D-CAA05784CAS: 2057-84-3 | Min. 95% | - - - | Discontinued product |

HJ 1154-2020 Aldehyde-DNPHs and Ketone-DNPHs Mixture 347 100 µg/mL in Acetonitrile
Ref: 04-A50000350AL
1ml | To inquire |

Valeraldehyde-2,4-DNPH
Ref: 3D-CAA05784
5g | Discontinued | Request information | |
10g | Discontinued | Request information |