CAS 20572-01-4

1-Methyl-1H-benzimidazole-2-carboxylic acid

Description:

1-Methyl-1H-benzimidazole-2-carboxylic acid is an organic compound characterized by its benzimidazole core, which features a methyl group at the 1-position and a carboxylic acid functional group at the 2-position. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential for hydrogen bonding due to the presence of the carboxylic acid group. It is likely to be soluble in polar solvents, reflecting the influence of the carboxylic acid moiety, while its aromatic structure may contribute to moderate solubility in non-polar solvents. The compound may participate in various chemical reactions, such as esterification or amidation, due to the reactive carboxylic acid group. Additionally, it may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, which could be explored in drug development. Overall, 1-Methyl-1H-benzimidazole-2-carboxylic acid is a versatile compound with applications in both synthetic chemistry and medicinal chemistry.

Formula: C₉H₈N₂O₂

InChI: InChI=1/C9H8N2O2/c1-11-7-5-3-2-4-6(7)10-8(11)9(12)13/h2-5H,1H3,(H,12,13)

SMILES: Cn1c2ccccc2nc1C(=O)O

1H-Benzimidazole-2-carboxylic acid, 1-methyl-

CAS: 20572-01-4

Formula: C₉H₈N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 176.1720

Ref: IN-DA002ABF

1-Methyl-1H-benzimidazole-2-carboxylic acid

CAS: 20572-01-4

1-Methyl-1H-benzimidazole-2-carboxylic acid

Formula: C₉H₈N₂O₂

Purity: Tech

Color and Shape: light red powder

Molecular weight: 176.17g/mol

Ref: 54-OR1861

1-Methyl-1H-benzo[d]imidazole-2-carboxylic acid

CAS: 20572-01-4

Purity: 95%

Molecular weight: 176.1750031

Ref: 10-F791579

1-Methyl-1H-benzimidazole-2-carboxylic acid

Controlled Product

CAS: 20572-01-4

1-Methyl-1H-benzimidazole-2-carboxylic acid is a synthetic compound that can be used as an antiprotozoal. It has been shown to have good activity against intestinalis, vaginalis, and intestinalis species. 1-Methyl-1H-benzimidazole-2-carboxylic acid binds to the acetyl groups of the parasite's cell membrane and inhibits the formation of the cytoplasmic membrane. This prevents the parasite from synthesizing ATP, which causes them to die. 1-Methyl-1H-benzimidazole-2-carboxylic acid also has strong activity against Giardia lamblia, which is caused by its ability to inhibit protein synthesis in this organism.

Formula: C₉H₈N₂O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 176.17 g/mol

Ref: 3D-FM167577