CAS 205744-16-7

2-Fluoro-3-pyridinemethanamine

Description:

2-Fluoro-3-pyridinemethanamine, with the CAS number 205744-16-7, is an organic compound characterized by the presence of a pyridine ring substituted with a fluorine atom and an amine group. This compound features a pyridine moiety, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and potential reactivity. The fluorine substitution at the 2-position of the pyridine ring can influence the compound's electronic properties, making it more reactive in certain chemical reactions. The amine group, located at the 3-position, imparts basic characteristics and can participate in hydrogen bonding, affecting its solubility and interaction with other molecules. 2-Fluoro-3-pyridinemethanamine may be of interest in medicinal chemistry and drug development due to its potential biological activity, particularly in the context of targeting specific receptors or enzymes. Its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample.

Formula: C₆H₇FN₂

InChI: InChI=1S/C6H7FN2/c7-6-5(4-8)2-1-3-9-6/h1-3H,4,8H2

InChI key: InChIKey=ORBSSWJRHPFEBR-UHFFFAOYSA-N

SMILES: C(N)C1=C(F)N=CC=C1

Synonyms:

• (2-Fluoropyridin-3-Yl)Methanamine
• 2-Fluoro-3-pyridinemethanamine
• 3-Aminomethyl-2-fluoropyridine
• [(2-Fluoropyridin-3-yl)methyl]amine
• 3-Pyridinemethanamine, 2-fluoro-

2-Fluoro-3-pyridinemethanamine

CAS: 205744-16-7

Formula: C₆H₇FN₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 126.1316

Ref: IN-DA002AB5

(2-Fluoropyridin-3-yl)methanamine

CAS: 205744-16-7

(2-Fluoropyridin-3-yl)methanamine

Purity: 95%

Molecular weight: 126.13g/mol

Ref: 54-PC403116

(2-Fluoropyridin-3-yl)methanamine

CAS: 205744-16-7

Formula: C₆H₇FN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 126.134

Ref: 10-F075875