CAS 205744-84-9: quinoxalin-2(1H)-ylidenepropanedial

Description:Quinoxalin-2(1H)-ylidenepropanedial, identified by its CAS number 205744-84-9, is an organic compound characterized by its unique structure that includes a quinoxaline moiety and a ylidene functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. Quinoxaline derivatives are known for their biological activity, often displaying antimicrobial, antitumor, and anti-inflammatory properties. The presence of the ylidene group suggests that it may participate in various chemical reactions, including condensation and nucleophilic addition. Additionally, the compound may exhibit fluorescence, making it of interest in materials science and organic electronics. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in synthetic chemistry and pharmacology. Overall, quinoxalin-2(1H)-ylidenepropanedial represents a versatile scaffold for further chemical modifications and potential applications in medicinal chemistry.

Formula:C₁₁H₈N₂O₂

InChI:InChI=1/C11H8N2O2/c14-6-8(7-15)11-5-12-9-3-1-2-4-10(9)13-11/h1-7,13H

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-(2-Quinoxalinyl)malondialdehyde REF: 10-F023411CAS: 205744-84-9	95.0%	186.00 €~643.00 €	Thu 10 Apr 25
Propanedial, 2-(2-quinoxalinyl)- REF: IN-DA002AB0CAS: 205744-84-9	- - -	To inquire	Mon 14 Apr 25
2-(Quinoxalin-2-yl)malondialdehyde REF: 54-OR7665CAS: 205744-84-9	95+%	166.00 €~794.00 €	Mon 21 Apr 25
2-(2-Quinoxalinyl)malondialdehyde REF: 3D-FIA74484CAS: 205744-84-9	Min. 95%	- - -	Discontinued product